Cyanidin 7-(3-glucosyl-6-malonylglucoside) 4'-glucoside
PubChem CID: 157009808
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Cyanidin 7-(3-glucosyl-6-malonylglucoside) 4'-glucoside |
|---|---|
| Topological Polar Surface Area | 349.0 |
| Hydrogen Bond Donor Count | 14.0 |
| Inchi Key | SETBQKBFKLYAIX-AVFAFASWSA-O |
| Rotatable Bond Count | 14.0 |
| Synonyms | Cyanidin 7-(3-glucosyl-6-malonylglucoside)-4'-glucoside |
| Heavy Atom Count | 60.0 |
| Compound Name | Cyanidin 7-(3-glucosyl-6-malonylglucoside) 4'-glucoside |
| Description | Cyanidin 7-(3-glucosyl-6-malonylglucoside) 4'-glucoside is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Cyanidin 7-(3-glucosyl-6-malonylglucoside) 4'-glucoside can be found in garden onion, which makes cyanidin 7-(3-glucosyl-6-malonylglucoside) 4'-glucoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 855.256 |
| Formal Charge | 1.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 855.256 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1410.0 |
| Hydrogen Bond Acceptor Count | 21.0 |
| Molecular Weight | 855.8 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 15.0 |
| Iupac Name | (2S,3R,4S,5S,6R)-2-[(2S,3R,4S,5R,6R)-2-[3,5-dihydroxy-2-[3-hydroxy-4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]chromenylium-7-yl]oxy-3,5-dihydroxy-6-(4-hydroxypenta-1,4-dien-2-yloxymethyl)oxan-4-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| Total Atom Stereocenter Count | 15.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C38H46O22/c1-13(41)5-14(2)53-12-25-28(47)35(60-37-32(51)30(49)27(46)24(11-40)58-37)33(52)38(59-25)54-16-7-18(42)17-9-20(44)34(55-22(17)8-16)15-3-4-21(19(43)6-15)56-36-31(50)29(48)26(45)23(10-39)57-36/h3-4,6-9,23-33,35-40,45-52H,1-2,5,10-12H2,(H3-,41,42,43,44)/p+1/t23-,24-,25-,26-,27-,28-,29+,30+,31-,32-,33-,35+,36-,37+,38-/m1/s1 |
| Smiles | C=C(CC(=C)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC2=CC(=C3C=C(C(=[O+]C3=C2)C4=CC(=C(C=C4)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)O)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C38H47O22+ |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Source_db:fooddb_chem_all