2''-O-alpha-L-Rhamnosyl-6-C-fucosyl-3'-methoxyluteolin
PubChem CID: 157009803
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2''-O-alpha-L-Rhamnosyl-6-C-fucosyl-3'-methoxyluteolin |
|---|---|
| Topological Polar Surface Area | 225.0 |
| Hydrogen Bond Donor Count | 8.0 |
| Inchi Key | KLULJHGQHYLYGV-FASCCRMCSA-N |
| Rotatable Bond Count | 5.0 |
| Heavy Atom Count | 42.0 |
| Compound Name | 2''-O-alpha-L-Rhamnosyl-6-C-fucosyl-3'-methoxyluteolin |
| Description | 2''-o-alpha-l-rhamnosyl-6-c-fucosyl-3'-methoxyluteolin is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). 2''-o-alpha-l-rhamnosyl-6-c-fucosyl-3'-methoxyluteolin can be found in corn, which makes 2''-o-alpha-l-rhamnosyl-6-c-fucosyl-3'-methoxyluteolin a potential biomarker for the consumption of this food product. |
| Exact Mass | 592.179 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 592.179 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 994.0 |
| Hydrogen Bond Acceptor Count | 14.0 |
| Molecular Weight | 592.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 9.0 |
| Iupac Name | 6-[(3R,4R,5S,6S)-4,5-dihydroxy-6-methyl-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]-5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)chromen-4-one |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C28H32O14/c1-9-21(33)24(36)27(42-28-25(37)23(35)20(32)10(2)40-28)26(39-9)19-14(31)8-17-18(22(19)34)13(30)7-15(41-17)11-4-5-12(29)16(6-11)38-3/h4-10,20-21,23-29,31-37H,1-3H3/t9-,10-,20-,21+,23+,24+,25+,26?,27+,28-/m0/s1 |
| Smiles | C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)O[C@@H]2[C@@H]([C@@H]([C@@H](OC2C3=C(C4=C(C=C3O)OC(=CC4=O)C5=CC(=C(C=C5)O)OC)O)C)O)O)O)O)O |
| Xlogp | -0.4 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C28H32O14 |
- 1. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:fooddb_chem_all