5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[1-(4-hydroxyphenyl)ethyl]-6-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one
PubChem CID: 157009797
Connections displayed (default: 10).
Loading graph...
| Topological Polar Surface Area | 197.0 |
|---|---|
| Hydrogen Bond Donor Count | 8.0 |
| Inchi Key | AEQPLRPDNSGKQU-GCOOXHSISA-N |
| Rotatable Bond Count | 5.0 |
| Heavy Atom Count | 40.0 |
| Compound Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[1-(4-hydroxyphenyl)ethyl]-6-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
| Description | Cucumerin b is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Cucumerin b can be found in cucumber, which makes cucumerin b a potential biomarker for the consumption of this food product. |
| Exact Mass | 552.163 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 552.163 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 912.0 |
| Hydrogen Bond Acceptor Count | 11.0 |
| Molecular Weight | 552.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-8-[1-(4-hydroxyphenyl)ethyl]-6-[(3R,4R,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]chromen-4-one |
| Total Atom Stereocenter Count | 6.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C29H28O11/c1-12(13-2-6-15(31)7-3-13)20-24(35)22(29-27(38)26(37)23(34)19(11-30)40-29)25(36)21-17(33)10-18(39-28(20)21)14-4-8-16(32)9-5-14/h2-10,12,19,23,26-27,29-32,34-38H,11H2,1H3/t12?,19-,23-,26+,27-,29?/m1/s1 |
| Smiles | CC(C1=CC=C(C=C1)O)C2=C3C(=C(C(=C2O)C4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)C(=O)C=C(O3)C5=CC=C(C=C5)O |
| Xlogp | 2.1 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C29H28O11 |
- 1. Outgoing r'ship
FOUND_INto/from Cucumis Sativus (Plant) Rel Props:Source_db:fooddb_chem_all