Quercetin 3-glucosyl-(1->2)-galactoside 7-glucoside
PubChem CID: 157009794
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Quercetin 3-glucosyl-(1->2)-galactoside 7-glucoside |
|---|---|
| Topological Polar Surface Area | 365.0 |
| Hydrogen Bond Donor Count | 14.0 |
| Inchi Key | MSUZWPXKWROYDK-UVDSTHNXSA-N |
| Rotatable Bond Count | 10.0 |
| Heavy Atom Count | 55.0 |
| Compound Name | Quercetin 3-glucosyl-(1->2)-galactoside 7-glucoside |
| Description | Quercetin 3-glucosyl-(1->2)-galactoside 7-glucoside is soluble (in water) and a very weakly acidic compound (based on its pKa). Quercetin 3-glucosyl-(1->2)-galactoside 7-glucoside can be found in fenugreek, which makes quercetin 3-glucosyl-(1->2)-galactoside 7-glucoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 788.201 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 788.201 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1340.0 |
| Hydrogen Bond Acceptor Count | 22.0 |
| Molecular Weight | 788.7 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 15.0 |
| Iupac Name | 3-[(2S,3R,4S,5R,6S)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(2S,3R,4S,5S,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Total Atom Stereocenter Count | 15.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C33H40O22/c34-6-15-19(40)23(44)26(47)31(51-15)49-10-4-13(39)18-14(5-10)50-28(9-1-2-11(37)12(38)3-9)29(22(18)43)54-33-30(25(46)21(42)17(8-36)53-33)55-32-27(48)24(45)20(41)16(7-35)52-32/h1-5,15-17,19-21,23-27,30-42,44-48H,6-8H2/t15-,16+,17-,19+,20+,21-,23-,24-,25-,26+,27+,30+,31+,32-,33-/m0/s1 |
| Smiles | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@@H](O4)CO)O)O)O)O)O[C@H]5[C@@H]([C@H]([C@H]([C@@H](O5)CO)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O |
| Xlogp | -3.0 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C33H40O22 |
- 1. Outgoing r'ship
FOUND_INto/from Trigonella Foenum-Graecum (Plant) Rel Props:Source_db:fooddb_chem_all