Cyanidin 3-(6''-caffeyl-6'''-ferulylsophoroside) 5-glucoside
PubChem CID: 157009775
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Cyanidin 3-(6''-caffeyl-6'''-ferulylsophoroside) 5-glucoside |
|---|---|
| Topological Polar Surface Area | 422.0 |
| Hydrogen Bond Donor Count | 15.0 |
| Inchi Key | CSWCMIODPBATKN-PPJFJRRFSA-O |
| Rotatable Bond Count | 19.0 |
| Synonyms | Cyanidin 3-(6''-caffeyl-6'''-ferulylsophoroside)-5-glucoside |
| Heavy Atom Count | 79.0 |
| Compound Name | Cyanidin 3-(6''-caffeyl-6'''-ferulylsophoroside) 5-glucoside |
| Description | Cyanidin 3-(6''-caffeyl-6'''-ferulylsophoroside) 5-glucoside is a member of the class of compounds known as flavonoid 3-o-p-coumaroyl glycosides. Flavonoid 3-o-p-coumaroyl glycosides are flavonoid 3-O-glycosides where the carbohydrate moiety is esterified with a p-coumaric acid. P-coumaric acid is an organic derivative of cinnamic acid, that carries a hydroxyl group at the 4-position of the benzene ring. Cyanidin 3-(6''-caffeyl-6'''-ferulylsophoroside) 5-glucoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Cyanidin 3-(6''-caffeyl-6'''-ferulylsophoroside) 5-glucoside can be found in radish and sweet potato, which makes cyanidin 3-(6''-caffeyl-6'''-ferulylsophoroside) 5-glucoside a potential biomarker for the consumption of these food products. |
| Exact Mass | 1111.29 |
| Formal Charge | 1.0 |
| Monoisotopic Mass | 1111.29 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 2000.0 |
| Hydrogen Bond Acceptor Count | 26.0 |
| Molecular Weight | 1112.0 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 15.0 |
| Iupac Name | [(2R,3S,4S,5R,6R)-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-3,4-dihydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-[[(E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoyl]oxymethyl]oxan-2-yl]oxyoxan-2-yl]methyl (E)-3-(3,4-dihydroxyphenyl)prop-2-enoate |
| Total Atom Stereocenter Count | 15.0 |
| Total Bond Stereocenter Count | 2.0 |
| Inchi | InChI=1S/C52H54O27/c1-70-33-13-22(3-8-28(33)57)5-11-39(61)71-19-36-41(63)44(66)47(69)51(77-36)79-49-45(67)42(64)37(20-72-38(60)10-4-21-2-7-26(55)29(58)12-21)78-52(49)75-34-17-25-31(73-48(34)23-6-9-27(56)30(59)14-23)15-24(54)16-32(25)74-50-46(68)43(65)40(62)35(18-53)76-50/h2-17,35-37,40-47,49-53,62-69H,18-20H2,1H3,(H5-,54,55,56,57,58,59,60,61)/p+1/t35-,36-,37-,40-,41-,42-,43+,44+,45+,46-,47-,49-,50-,51+,52+/m1/s1 |
| Smiles | COC1=C(C=CC(=C1)/C=C/C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O[C@@H]3[C@H]([C@@H]([C@H](O[C@@H]3OC4=C([O+]=C5C=C(C=C(C5=C4)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)C7=CC(=C(C=C7)O)O)COC(=O)/C=C/C8=CC(=C(C=C8)O)O)O)O)O)O)O)O |
| Defined Bond Stereocenter Count | 2.0 |
| Molecular Formula | C52H55O27+ |
- 1. Outgoing r'ship
FOUND_INto/from Ipomoea Batatas (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Raphanus Sativus (Plant) Rel Props:Source_db:fooddb_chem_all