Cyanidin 3-[6''-(4-glucosyl-p-coumaryl)sophoroside] 5-glucoside
PubChem CID: 157009773
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Cyanidin 3-[6''-(4-glucosyl-p-coumaryl)sophoroside] 5-glucoside |
|---|---|
| Topological Polar Surface Area | 445.0 |
| Hydrogen Bond Donor Count | 17.0 |
| Inchi Key | JSIMVXMJRFINRS-ZOPAOLMESA-O |
| Rotatable Bond Count | 17.0 |
| Synonyms | Cyanidin 3-[6''-(4-glucosyl-p-coumaryl)sophoroside]-5-glucoside |
| Heavy Atom Count | 76.0 |
| Compound Name | Cyanidin 3-[6''-(4-glucosyl-p-coumaryl)sophoroside] 5-glucoside |
| Description | Cyanidin 3-[6''-(4-glucosyl-p-coumaryl)sophoroside] 5-glucoside is a member of the class of compounds known as anthocyanidin 3-o-6-p-coumaroyl glycosides. Anthocyanidin 3-o-6-p-coumaroyl glycosides are anthocyanidin 3-O-glycosides where the carbohydrate moiety is esterified at the C6 position with a p-coumaric acid. P-coumaric acid is an organic derivative of cinnamic acid, that carries a hydroxyl group at the 4-position of the benzene ring. Cyanidin 3-[6''-(4-glucosyl-p-coumaryl)sophoroside] 5-glucoside is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Cyanidin 3-[6''-(4-glucosyl-p-coumaryl)sophoroside] 5-glucoside can be found in cauliflower, which makes cyanidin 3-[6''-(4-glucosyl-p-coumaryl)sophoroside] 5-glucoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 1081.3 |
| Formal Charge | 1.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 1081.3 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1850.0 |
| Hydrogen Bond Acceptor Count | 27.0 |
| Molecular Weight | 1081.9 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 20.0 |
| Iupac Name | [(2R,3S,4S,5R,6R)-6-[2-(3,4-dihydroxyphenyl)-7-hydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromenylium-3-yl]oxy-3,4-dihydroxy-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]methyl (E)-3-[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoate |
| Total Atom Stereocenter Count | 20.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 1.0 |
| Inchi | InChI=1S/C48H56O28/c49-13-27-32(56)36(60)40(64)45(72-27)68-20-5-1-17(2-6-20)3-8-31(55)67-16-30-35(59)39(63)44(76-47-42(66)38(62)34(58)29(15-51)74-47)48(75-30)71-26-12-21-24(69-43(26)18-4-7-22(53)23(54)9-18)10-19(52)11-25(21)70-46-41(65)37(61)33(57)28(14-50)73-46/h1-12,27-30,32-42,44-51,56-66H,13-16H2,(H2-,52,53,54)/p+1/b8-3+/t27-,28-,29-,30-,32-,33-,34-,35-,36+,37+,38+,39+,40-,41-,42-,44-,45-,46-,47+,48+/m1/s1 |
| Smiles | C1=CC(=CC=C1/C=C/C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@H](O2)OC3=C([O+]=C4C=C(C=C(C4=C3)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O)C6=CC(=C(C=C6)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O |
| Is Pains | True |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C48H57O28+ |
- 1. Outgoing r'ship
FOUND_INto/from Brassica Oleracea (Plant) Rel Props:Source_db:fooddb_chem_all