23-O-beta-D-Glucopyranosyl-25-methyldolichosterone
PubChem CID: 157009757
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 23-O-beta-D-Glucopyranosyl-25-methyldolichosterone |
|---|---|
| Topological Polar Surface Area | 177.0 |
| Hydrogen Bond Donor Count | 7.0 |
| Inchi Key | NLNNWFCVCWSYSK-UOECHDJWSA-N |
| Rotatable Bond Count | 8.0 |
| Heavy Atom Count | 45.0 |
| Compound Name | 23-O-beta-D-Glucopyranosyl-25-methyldolichosterone |
| Description | 23-o-beta-d-glucopyranosyl-25-methyldolichosterone is a member of the class of compounds known as steroidal glycosides. Steroidal glycosides are sterol lipids containing a carbohydrate moiety glycosidically linked to the steroid skeleton. 23-o-beta-d-glucopyranosyl-25-methyldolichosterone is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 23-o-beta-d-glucopyranosyl-25-methyldolichosterone can be found in common bean, green bean, and yellow wax bean, which makes 23-o-beta-d-glucopyranosyl-25-methyldolichosterone a potential biomarker for the consumption of these food products. |
| Exact Mass | 638.403 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 638.403 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1110.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 638.8 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 13.0 |
| Iupac Name | (2R,3S,5S,10R,13S)-2,3-dihydroxy-17-[(2S,3R,4R)-3-hydroxy-6,6-dimethyl-5-methylidene-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
| Total Atom Stereocenter Count | 17.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C35H58O10/c1-16(27(40)31(17(2)33(3,4)5)45-32-30(43)29(42)28(41)26(15-36)44-32)19-8-9-20-18-12-23(37)22-13-24(38)25(39)14-35(22,7)21(18)10-11-34(19,20)6/h16,18-22,24-32,36,38-43H,2,8-15H2,1,3-7H3/t16-,18?,19?,20?,21?,22+,24-,25+,26+,27+,28+,29-,30+,31+,32-,34+,35+/m0/s1 |
| Smiles | C[C@@H](C1CCC2[C@@]1(CCC3C2CC(=O)[C@@H]4[C@@]3(C[C@H]([C@H](C4)O)O)C)C)[C@H]([C@@H](C(=C)C(C)(C)C)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O |
| Xlogp | 3.5 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C35H58O10 |
- 1. Outgoing r'ship
FOUND_INto/from Phaseolus Vulgaris (Plant) Rel Props:Source_db:fooddb_chem_all