24-Methyllathosterol ferulate
PubChem CID: 157009743
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 24-Methyllathosterol ferulate, 24-Methyllathosterol ferulic acid |
|---|---|
| Prediction Swissadme | 0.0 |
| Topological Polar Surface Area | 55.8 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | OZCGBWSNAGOZDD-HATWAXMMSA-N |
| Fcsp3 | 0.7105263157894737 |
| Rotatable Bond Count | 10.0 |
| Heavy Atom Count | 42.0 |
| Compound Name | 24-Methyllathosterol ferulate |
| Description | 24-methyllathosterol ferulate is a member of the class of compounds known as steroid esters. Steroid esters are compounds containing a steroid moiety which bears a carboxylic acid ester group. 24-methyllathosterol ferulate is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 24-methyllathosterol ferulate can be found in corn, which makes 24-methyllathosterol ferulate a potential biomarker for the consumption of this food product. |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 576.418 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 576.418 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 999.0 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 576.8 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 6.0 |
| Iupac Name | [(3S,5S,10S,13R,17R)-17-[(2R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enoate |
| Total Atom Stereocenter Count | 9.0 |
| Total Bond Stereocenter Count | 1.0 |
| Prediction Hob | 0.0 |
| Esol | -9.672558685714288 |
| Inchi | InChI=1S/C38H56O4/c1-24(2)25(3)8-9-26(4)31-14-15-32-30-13-12-28-23-29(18-20-37(28,5)33(30)19-21-38(31,32)6)42-36(40)17-11-27-10-16-34(39)35(22-27)41-7/h10-11,13,16-17,22,24-26,28-29,31-33,39H,8-9,12,14-15,18-21,23H2,1-7H3/b17-11+/t25?,26-,28+,29+,31-,32?,33?,37+,38-/m1/s1 |
| Smiles | C[C@H](CCC(C)C(C)C)[C@H]1CCC2[C@@]1(CCC3C2=CC[C@@H]4[C@@]3(CC[C@@H](C4)OC(=O)/C=C/C5=CC(=C(C=C5)O)OC)C)C |
| Xlogp | 10.8 |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C38H56O4 |
- 1. Outgoing r'ship
FOUND_INto/from Zea Mays (Plant) Rel Props:Source_db:cmaup_ingredients