2,3-Dimethylquinoline
PubChem CID: 15591
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2,3-DIMETHYLQUINOLINE, 1721-89-7, Quinoline, 2,3-dimethyl-, EINECS 217-016-0, DTXSID00169207, MFCD03085977, SCHEMBL422035, DTXCID5091698, BAA72189, AKOS005079387, SB68504, DB-081648, CS-0258436, NS00010749, EN300-701405, G71553, AO-801/41077381, 11T-0826, 217-016-0 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 12.9 |
| Hydrogen Bond Donor Count | 0.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2CCCCC2C1 |
| Np Classifier Class | Quinazoline alkaloids |
| Deep Smiles | Ccccccccc6nc%10C |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Quinolines and derivatives |
| Scaffold Graph Node Level | C1CCC2NCCCC2C1 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 155.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,3-dimethylquinoline |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 3.0 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C11H11N |
| Scaffold Graph Node Bond Level | c1ccc2ncccc2c1 |
| Inchi Key | FBOFHVFMPNNIKN-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | dimethylquinoline |
| Esol Class | Soluble |
| Functional Groups | cnc |
| Compound Name | 2,3-Dimethylquinoline |
| Exact Mass | 157.089 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 157.089 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 157.21 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C11H11N/c1-8-7-10-5-3-4-6-11(10)12-9(8)2/h3-7H,1-2H3 |
| Smiles | CC1=CC2=CC=CC=C2N=C1C |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Anthranilic acid alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Chrysopogon Zizanioides (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2005.9699005