8-Hydroxyfalcarinone
PubChem CID: 15559228
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 8-Hydroxyfalcarinone |
|---|---|
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Inchi Key | STNWZOBISHHDCD-GXDHUFHOSA-N |
| Rotatable Bond Count | 9.0 |
| Heavy Atom Count | 19.0 |
| Compound Name | 8-Hydroxyfalcarinone |
| Description | 8-hydroxyfalcarinone is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). 8-hydroxyfalcarinone can be found in wild celery, which makes 8-hydroxyfalcarinone a potential biomarker for the consumption of this food product. |
| Exact Mass | 258.162 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 258.162 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 431.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 258.35 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (9E)-8-hydroxyheptadeca-1,9-dien-4,6-diyn-3-one |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 1.0 |
| Inchi | InChI=1S/C17H22O2/c1-3-5-6-7-8-9-10-14-17(19)15-12-11-13-16(18)4-2/h4,10,14,17,19H,2-3,5-9H2,1H3/b14-10+ |
| Smiles | CCCCCCC/C=C/C(C#CC#CC(=O)C=C)O |
| Xlogp | 4.9 |
| Defined Bond Stereocenter Count | 1.0 |
| Molecular Formula | C17H22O2 |
- 1. Outgoing r'ship
FOUND_INto/from Apium Graveolens (Plant) Rel Props:Source_db:fooddb_chem_all