Physalin H
PubChem CID: 155551
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Physalin H, 70241-09-7, 16,24-Cyclo-13,14-secoergost-2-ene-18,26-dioic acid, 5-chloro-14,17:14,27-diepoxy-6,13,20,22-tetrahydroxy-1,15-dioxo-, .gamma.-lactone .delta.-lactone, 14-chloro-5,15-dihydroxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-ene-4,10,22,29-tetrone, 6,7-Dehydrophysalin H, NSC688074, Neuro_000435, CHEBI:169597, chloro-dihydroxy-trimethyl-[?]tetrone, DA-59879, (13S,14R,22R,25S)-1,15-Dioxo-5-chloro-6beta,13,20,22-tetrahydroxy-14,17alpha:14,27-diepoxy-16beta,24-cyclo-13,14-seco-5alpha-ergosta-2-ene-18,26-dioic acid 18,20:26,22-dilactone, 14-Chloro-5,15-dihydroxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.1~18,27~.0~1,5~.0~2,24~.0~8,17~.0~9,14~.0~21,26~]nonacos-11-ene-4,10,22,29-tetrone |
|---|---|
| Topological Polar Surface Area | 146.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 39.0 |
| Description | From the famine food Physalis angulata (cutleaf ground cherry). Physalin H is found in herbs and spices and fruits. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1330.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 14-chloro-5,15-dihydroxy-2,9,26-trimethyl-3,19,23,28-tetraoxaoctacyclo[16.9.1.118,27.01,5.02,24.08,17.09,14.021,26]nonacos-11-ene-4,10,22,29-tetrone |
| Nih Violation | True |
| Prediction Hob | 0.0 |
| Xlogp | 0.4 |
| Is Pains | False |
| Molecular Formula | C28H31ClO10 |
| Prediction Swissadme | 0.0 |
| Inchi Key | YNEPXUIPALKHAU-UHFFFAOYSA-N |
| Fcsp3 | 0.7857142857142857 |
| Logs | -3.976 |
| Rotatable Bond Count | 0.0 |
| Logd | 2.013 |
| Synonyms | Physalin H |
| Compound Name | Physalin H |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 562.161 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 562.161 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 563.0 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 13.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -3.6014938000000023 |
| Inchi | InChI=1S/C28H31ClO10/c1-22-10-17-24(3)28-18(22)19(32)27(39-28,36-11-14(22)20(33)37-17)13-9-16(31)25(29)7-4-5-15(30)23(25,2)12(13)6-8-26(28,35)21(34)38-24/h4-5,12-14,16-18,31,35H,6-11H2,1-3H3 |
| Smiles | CC12CC3C4(C56C1C(=O)C(O5)(C7CC(C8(CC=CC(=O)C8(C7CCC6(C(=O)O4)O)C)Cl)O)OCC2C(=O)O3)C |
| Nring | 8.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Physalis Alkekengi (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all