Glycyl-L-alanine
PubChem CID: 1551643
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Glycyl-L-alanine, 3695-73-6, Gly-ala, (S)-2-(2-Aminoacetamido)propanoic acid, Glycylalanine, N-Glycylalanine, Glycylalanine, L-, N-Glycyl-L-alanine, Glycine-alanine dipeptide, Alanine, glycyl-, Alanine, N-glycyl-, L-, (2S)-2-[(2-aminoacetyl)amino]propanoic acid, L-ALANINE, GLYCYL-, L-Alanine, N-glycyl-, (2S)-2-(2-aminoacetamido)propanoic acid, CHEMBL91241, 2M7GF488BL, CHEBI:73855, Gly-Ala-OH, NSC 83246, Gly-L-Ala, H-Gly-Ala-OH, MFCD00065112, Glycine-.alpha.-alanine, UNII-2M7GF488BL, glycyl-alanine, L-glycylalanine, GlyAla, NSC-83246, EINECS 223-019-8, GLYCYL-(S)-ALANINE, N-(Aminoacetyl)alanine, L-, SCHEMBL564562, DTXSID501316691, BDBM50188530, Gly-Ala, >=99.0% (NT), AKOS010397041, AKOS015855052, FG47684, HY-W141910, AS-48944, TS-04148, CS-0201701, G0113, NS00042144, (S)-2-(2-Amino-acetylamino)-propionic acid, EN300-864048, Q27144182 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 92.4 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Np Classifier Class | Dipeptides |
| Deep Smiles | C[C@@H]C=O)O))NC=O)CN |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Classyfire Subclass | Amino acids, peptides, and analogues |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 146.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 1.0 |
| Iupac Name | (2S)-2-[(2-aminoacetyl)amino]propanoic acid |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | -3.7 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C5H10N2O3 |
| Inchi Key | VPZXBVLAVMBEQI-VKHMYHEASA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 3.0 |
| Synonyms | glycyl-l-alanine |
| Esol Class | Highly soluble |
| Functional Groups | CC(=O)NC, CC(=O)O, CN |
| Compound Name | Glycyl-L-alanine |
| Exact Mass | 146.069 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 146.069 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 146.14 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C5H10N2O3/c1-3(5(9)10)7-4(8)2-6/h3H,2,6H2,1H3,(H,7,8)(H,9,10)/t3-/m0/s1 |
| Smiles | C[C@@H](C(=O)O)NC(=O)CN |
| Np Classifier Biosynthetic Pathway | Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Small peptides |
- 1. Outgoing r'ship
FOUND_INto/from Blighia Sapida (Plant) Rel Props:Reference:ISBN:9788185042053