2-Aminofluorene
PubChem CID: 1539
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-aminofluorene, 9H-Fluoren-2-amine, 153-78-6, 2-Fluorenamine, Aminofluoren, Fluorene, 2-amino-, 2-Fluoreneamine, Fluoren-2-amine, 2-Fluorenylamine, 2-Fluroenylamine, Fluoren-2-ylamine, Aminofluoren [German], CCRIS 31, HSDB 4026, EINECS 205-817-8, NSC 12274, UNII-3A69OS195N, BRN 1945861, DTXSID1049223, 3A69OS195N, MFCD00001125, NSC-12274, AMINOFLUORENE, 2-, 2-AMINOFLUORENE [HSDB], DTXCID3029079, 4-12-00-03370 (Beilstein Handbook Reference), AMINOFLUOREN (GERMAN), WLN: L B656 HHJ EZ, 9H-Fluoren-2-ylamine, 2Fluorenylamine, Fluoren2ylamine, 2Fluorenamine, 2Fluoreneamine, Fluoren2amine, 2-Aminoflurene, 9HFluoren2amine, 2-amino-fluorene, Fluorene, 2amino, Fluorene, 2-amino, 2-Amino-9H-fluorene, 9H-fluoren-2-yl-amine, 2-Aminofluorene, 98%, N-2-FLUORENYLAMINE, Oprea1_099026, MLS000589201, CHEMBL84472, SCHEMBL225901, SCHEMBL4185603, SGCUT00125, HMS1608K17, HMS2538L16, KNA08108, NSC12274, NSC26328, to_000026, Tox21_202971, NSC-26328, STK093094, AKOS000111311, AC-4871, CS-W017149, FA33811, HY-W016433, NCGC00246308-01, NCGC00260517-01, AS-14460, BP-12358, CAS-153-78-6, NCI60_000536, PD196987, SMR000219736, SY049251, DB-043201, A0621, EU-0034581, NS00024998, EN300-17389, D70520, SR-01000398070, SR-01000398070-1, Q26840753, F0037-4040, 205-817-8 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 26.0 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CC1CCCCC12 |
| Np Classifier Class | Anthraquinones and anthrones |
| Deep Smiles | Ncccc-ccCc5c9)))cccc6 |
| Heavy Atom Count | 14.0 |
| Classyfire Class | Fluorenes |
| Scaffold Graph Node Level | C1CCC2C(C1)CC1CCCCC12 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 213.0 |
| Database Name | hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 9H-fluoren-2-amine |
| Nih Violation | False |
| Class | Fluorenes |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 3.1 |
| Superclass | Benzenoids |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C13H11N |
| Scaffold Graph Node Bond Level | c1ccc2c(c1)Cc1ccccc1-2 |
| Inchi Key | CFRFHWQYWJMEJN-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | 2-Fluorenamine, 2-Fluorenylamine, 2-Aminoflurene, 2-aminofluorene |
| Esol Class | Soluble |
| Functional Groups | cN |
| Compound Name | 2-Aminofluorene |
| Kingdom | Organic compounds |
| Exact Mass | 181.089 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 181.089 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 181.23 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C13H11N/c14-11-5-6-13-10(8-11)7-9-3-1-2-4-12(9)13/h1-6,8H,7,14H2 |
| Smiles | C1C2=CC=CC=C2C3=C1C=C(C=C3)N |
| Np Classifier Biosynthetic Pathway | Polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Fluorenes |
| Np Classifier Superclass | Polycyclic aromatic polyketides |
- 1. Outgoing r'ship
FOUND_INto/from Nelumbo Nucifera (Plant) Rel Props:Reference:ISBN:9788185042145