Junosine
PubChem CID: 15286413
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Junosine, 103956-34-9, 9(10H)-Acridinone, 1,3,5-trihydroxy-10-methyl-2-(3-methyl-2-buten-1-yl)-, 1,3,5-trihydroxy-10-methyl-2-(3-methylbut-2-enyl)acridin-9-one, 1,3,5-Trihydroxy-10-methyl-2-(3-methyl-2-buten-1-yl)-9(10H)-acridinone, MJ25P8L4CA, CHEBI:175152, DTXSID901153938, DEA95634, AKOS040763315, 1,3,5-Trihydroxy-10-methyl-2-prenylacridone, F92774, 10-methyl-2-(3-methylbut-2-enyl)-1,3,5-tris(oxidanyl)acridin-9-one, 9(10H)-Acridinone, 1,3,5-trihydroxy-10-methyl-2-(3-methyl-2-butenyl)- |
|---|---|
| Topological Polar Surface Area | 81.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Heavy Atom Count | 24.0 |
| Description | Alkaloid from the bark of Citrus junos (yuzu). Junosine is found in citrus. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 515.0 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 1,3,5-trihydroxy-10-methyl-2-(3-methylbut-2-enyl)acridin-9-one |
| Prediction Hob | 1.0 |
| Xlogp | 4.5 |
| Molecular Formula | C19H19NO4 |
| Prediction Swissadme | 0.0 |
| Inchi Key | YDKCXKMKJZNVHQ-UHFFFAOYSA-N |
| Fcsp3 | 0.2105263157894736 |
| Logs | -3.319 |
| Rotatable Bond Count | 2.0 |
| Logd | 2.417 |
| Synonyms | 1,3,5-Trihydroxy-10-methyl-2-prenylacridone, Junosine |
| Compound Name | Junosine |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 325.131 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 325.131 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 325.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -5.659723466666667 |
| Inchi | InChI=1S/C19H19NO4/c1-10(2)7-8-11-15(22)9-13-16(18(11)23)19(24)12-5-4-6-14(21)17(12)20(13)3/h4-7,9,21-23H,8H2,1-3H3 |
| Smiles | CC(=CCC1=C(C=C2C(=C1O)C(=O)C3=C(N2C)C(=CC=C3)O)O)C |
| Nring | 3.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Catharanthus Roseus (Plant) Rel Props:Source_db:cmaup_ingredients - 2. Outgoing r'ship
FOUND_INto/from Cinnamomum Tenuifolium (Plant) Rel Props:Source_db:cmaup_ingredients - 3. Outgoing r'ship
FOUND_INto/from Citrus Junos (Plant) Rel Props:Source_db:cmaup_ingredients - 4. Outgoing r'ship
FOUND_INto/from Clematis Flammula (Plant) Rel Props:Source_db:cmaup_ingredients - 5. Outgoing r'ship
FOUND_INto/from Gentiana Lactea (Plant) Rel Props:Source_db:cmaup_ingredients - 6. Outgoing r'ship
FOUND_INto/from Hortia Arborea (Plant) Rel Props:Source_db:cmaup_ingredients - 7. Outgoing r'ship
FOUND_INto/from Moringa Oleifera (Plant) Rel Props:Source_db:cmaup_ingredients - 8. Outgoing r'ship
FOUND_INto/from Pluchea Dioscoridis (Plant) Rel Props:Source_db:cmaup_ingredients - 9. Outgoing r'ship
FOUND_INto/from Pyrola Rotundifolia (Plant) Rel Props:Source_db:cmaup_ingredients - 10. Outgoing r'ship
FOUND_INto/from Stevia Alpina (Plant) Rel Props:Source_db:cmaup_ingredients - 11. Outgoing r'ship
FOUND_INto/from Strophanthus Eminii (Plant) Rel Props:Source_db:cmaup_ingredients