5-Hydroxypipecolic acid
PubChem CID: 151730
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5-hydroxypiperidine-2-carboxylic acid, 13096-31-6, 5-Hydroxypipecolic acid, 2-Piperidinecarboxylic acid, 5-hydroxy-, 0U5R8QIF9U, 5-Hydroxy-2-piperidinecarboxylic acid, MFCD08694639, CHEBI:74048, DTXSID10926984, (2S,5R)-5-Hydroxypipecolic acid, L-trans-5-Hydroxy-2-piperidinecarboxylic acid, (2S,5S)-5-HYDROXY-2-PIPERIDINECARBOXYLIC ACID, cis-5-hydroxypiperidine-2-carboxylic acid, 17027-45-1, 5-hydroxy piperidine-2-carboxylic acid, MFCD19217172, TRANS-5-HYDROXYPIPERIDINE-2-CARBOXYLIC ACID, UNII-0U5R8QIF9U, (2R,5R)-5-HYDROXY-2-PIPERIDINECARBOXYLIC ACID, SCHEMBL497510, DTXCID80886167, 5-hydroxypiperidine-2-carboxylicacid, ZB1686, AKOS000280489, AKOS023397775, PB18272, SB20390, SB22744, SB37393, SB41273, 5-Hydroxy-2-piperidinecarboxylic acid #, BS-15164, SY098400, SY232837, DB-062786, CS-0138318, EN300-188200, F30864, (2S,5S)-5-Hydroxy-piperidine-2-carboxylic acid, Q27144360, Z1198181269, racemic (2R*,5S*)-5-hydroxypiperidine-2-carboxylic acid, 868-044-0 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 69.6 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Np Classifier Class | Aminoacids |
| Deep Smiles | OCCCCNC6))C=O)O |
| Heavy Atom Count | 10.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Scaffold Graph Node Level | C1CCNCC1 |
| Classyfire Subclass | Amino acids, peptides, and analogues |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 137.0 |
| Database Name | hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5-hydroxypiperidine-2-carboxylic acid |
| Nih Violation | False |
| Class | Carboxylic acids and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | -3.0 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Amino acids, peptides, and analogues |
| Gsk 4 400 Rule | True |
| Molecular Formula | C6H11NO3 |
| Scaffold Graph Node Bond Level | C1CCNCC1 |
| Inchi Key | RKEYKDXXZCICFZ-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 1.0 |
| State | Solid |
| Synonyms | L-trans-5-Hydroxy-2-piperidinecarboxylate, L-trans-5-Hydroxypipecolic acid, 5-Hydroxypipecolic acid, cis-isomer, 5-Hydroxypipecolic acid, ion (1-)-cis-isomer, 5-Hydroxypipecolic acid, trans-isomer, 5-Hydroxypipecolic acid, (3b,4b,5a,24Z)-4-Methylstigmasta-7,24(28)-dien-3-ol, (3Β,4β,5α,24Z)-4-methylstigmasta-7,24(28)-dien-3-ol, 5-Hydroxypipecolate, (2s,5r)-5-hydroxy-2-piperidinecarboxylic acid, 5-hydroxy-pipecolic-acid |
| Esol Class | Highly soluble |
| Functional Groups | CC(=O)O, CNC, CO |
| Compound Name | 5-Hydroxypipecolic acid |
| Kingdom | Organic compounds |
| Exact Mass | 145.074 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 145.074 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 145.16 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic heteromonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C6H11NO3/c8-4-1-2-5(6(9)10)7-3-4/h4-5,7-8H,1-3H2,(H,9,10) |
| Smiles | C1CC(NCC1O)C(=O)O |
| Np Classifier Biosynthetic Pathway | Amino acids and Peptides |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Alpha amino acids |
| Np Classifier Superclass | Small peptides |
- 1. Outgoing r'ship
FOUND_INto/from Morus Alba (Plant) Rel Props:Reference:https://doi.org/10.2174/0929867033456729 - 2. Outgoing r'ship
FOUND_INto/from Salix Alba (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279