N-methylpent-4-enehydrazide
PubChem CID: 15133708
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 46.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Deep Smiles | CNC=O)CCC=C)))))N |
| Heavy Atom Count | 9.0 |
| Classyfire Class | Carboxylic acids and derivatives |
| Classyfire Subclass | Carboxylic acid derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 112.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | N-methylpent-4-enehydrazide |
| Veber Rule | True |
| Classyfire Superclass | Organic acids and derivatives |
| Xlogp | 0.0 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C6H12N2O |
| Inchi Key | PUZPWTIAQVGQNY-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 3.0 |
| Synonyms | 1-methyl-1-(pent-4-enoyl) hydrazine |
| Esol Class | Very soluble |
| Functional Groups | C=CC, CC(=O)N(C)N |
| Compound Name | N-methylpent-4-enehydrazide |
| Exact Mass | 128.095 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 128.095 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 128.169 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C6H12N2O/c1-3-4-5-6(9)8(2)7/h3H,1,4-5,7H2,2H3 |
| Smiles | CN(C(=O)CCC=C)N |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2013.764215