3-Oxo-Erythrodiol
PubChem CID: 15127783
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 3-Oxo-Erythrodiol, 28-hydroxyolean-12-en-3-one, 28-Hydroxy-12-oleanen-3-one, CHEMBL1631831, HY-N13161, (4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picen-3-one |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2C(CCC3C2CCC2C4CCCCC4CCC23)C1 |
| Np Classifier Class | Oleanane triterpenoids |
| Deep Smiles | OC[C@@]CC[C@@]C=CC[C@H][C@@]6C)CC[C@@H][C@]6C)CCC=O)C6C)C)))))))))))))[C@@H]6CCCC%10))C)C)))))C |
| Heavy Atom Count | 32.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CCC2C(CCC3C2CCC2C4CCCCC4CCC23)C1 |
| Classyfire Subclass | Triterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 851.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 7.0 |
| Uniprot Id | P18031 |
| Iupac Name | (4aR,6aR,6bS,8aS,12aS,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6b,11,11,14b-heptamethyl-2,4a,5,6,7,8,9,10,12,12a,14,14a-dodecahydro-1H-picen-3-one |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 7.2 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C30H48O2 |
| Scaffold Graph Node Bond Level | O=C1CCC2C(CCC3C4CCC5CCCCC5C4=CCC23)C1 |
| Inchi Key | LCZGVWKWRGLAFX-CHMVMOPFSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 1.0 |
| Synonyms | 28-hydroxy-beta-amyrone, 28-hydroxy-β-amyrone |
| Esol Class | Poorly soluble |
| Functional Groups | CC(C)=O, CC=C(C)C, CO |
| Compound Name | 3-Oxo-Erythrodiol |
| Exact Mass | 440.365 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 440.365 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 440.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 7.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C30H48O2/c1-25(2)14-16-30(19-31)17-15-28(6)20(21(30)18-25)8-9-23-27(5)12-11-24(32)26(3,4)22(27)10-13-29(23,28)7/h8,21-23,31H,9-19H2,1-7H3/t21-,22-,23+,27-,28+,29+,30+/m0/s1 |
| Smiles | C[C@]12CCC(=O)C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4CC(CC5)(C)C)CO)C)C)(C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Agrostophyllum Brevipes (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Anodendron Paniculatum (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Bolbostemma Paniculatum (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Clerodendrum Paniculatum (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Derris Amazonica (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Derris Benthamii (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Derris Brevipes (Plant) Rel Props:Source_db:npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Derris Elliptica (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Derris Eriocarpa (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Derris Ferruginea (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Derris Indica (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Derris Malaccensis (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Derris Reticulata (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Derris Robusta (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Derris Scandens (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Derris Trifoliata (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Derris Uliginosa (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Glossocalyx Brevipes (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Hyptis Brevipes (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Lasiocephalus Ovatus (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Lycopodium Paniculatum (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Monodora Brevipes (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Pistacia Lentiscus (Plant) Rel Props:Reference:ISBN:9788172362461