gamma-Glu-leu
PubChem CID: 151023
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | gamma-Glu-leu, 2566-39-4, h-gamma-glu-leu-oh, gamma-Glutamylleucine, h-glu(leu-oh)-oh, gamma-Glutamyl-leucine, H-, A-Glu-Leu-OH, L-gamma-glutamyl-L-leucine, L-gamma-Glu-L-Leu, MFCD00037213, (2S)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-4-methylpentanoic acid, N-L-?-GLUTAMYL-L-LEUCINE, (S)-2-Amino-5-(((S)-1-carboxy-3-methylbutyl)amino)-5-oxopentanoic acid, (S)-2-Amino-5-((S)-1-carboxy-3-methylbutylamino)-5- oxopentanoic acid, g-Glu-Leu, H-g-Glu-Leu-OH, H--Glu-Leu-OH, SCHEMBL234161, CHEBI:68433, L-Leucine, N-L-gamma-glutamyl-, HY-P4632, AKOS025401632, AC-23913, DA-74126, FG108034, CS-0655429, Q27136932, Z3244606442 |
|---|---|
| Topological Polar Surface Area | 130.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 18.0 |
| Description | Gamma-glutamylleucine, also known as gamma-glutamyl-leucine, (d,l)-isomer or L-gamma-glu-L-leu, is a member of the class of compounds known as dipeptides. Dipeptides are organic compounds containing a sequence of exactly two alpha-amino acids joined by a peptide bond. Gamma-glutamylleucine is slightly soluble (in water) and a moderately acidic compound (based on its pKa). Gamma-glutamylleucine can be found in soft-necked garlic, which makes gamma-glutamylleucine a potential biomarker for the consumption of this food product. Gamma-glutamylleucine can be found primarily in blood and feces. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 317.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (2S)-2-[[(4S)-4-amino-4-carboxybutanoyl]amino]-4-methylpentanoic acid |
| Nih Violation | False |
| Class | Carboxylic acids and derivatives |
| Xlogp | -2.4 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C11H20N2O5 |
| Inchi Key | MYFMARDICOWMQP-YUMQZZPRSA-N |
| Rotatable Bond Count | 8.0 |
| State | Solid |
| Synonyms | L-gamma-Glu-L-leu, L-g-Glu-L-leu, L-Γ-glu-L-leu, g-Glutamylleucine, Γ-glutamylleucine, Γ-glu-leu, Γ-L-glu-L-leu, Γ-L-glutamyl-L-leucine, L-Γ-glutamyl-L-leucine, N-Γ-glutamylleucine, N-L-Γ-glutamylleucine, N-L-Γ-glutamyl-L-leucine, gamma-Glu-leu, gamma-L-Glu-L-leu, gamma-L-Glutamyl-L-leucine, L-gamma-Glutamyl-L-leucine, N-L-gamma-Glutamylleucine, N-L-gamma-Glutamyl-L-leucine, g-L-Glutamyl-L-leucine, gamma-Glutamyl-leucine, N-Γ-L-glutamyl-L-leucine, N-gamma-Glutamylleucine, N-gamma-L-Glutamyl-L-leucine, g-Glu-leu, gamma-Glutamylleucine |
| Compound Name | gamma-Glu-leu |
| Kingdom | Organic compounds |
| Exact Mass | 260.137 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 260.137 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 260.29 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Inchi | InChI=1S/C11H20N2O5/c1-6(2)5-8(11(17)18)13-9(14)4-3-7(12)10(15)16/h6-8H,3-5,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18)/t7-,8-/m0/s1 |
| Smiles | CC(C)C[C@@H](C(=O)O)NC(=O)CC[C@@H](C(=O)O)N |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Dipeptides |
- 1. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:fooddb_chem_all