Antimycin A
PubChem CID: 14957
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Antimycin A, Antipiricullin, Antimycin A1b, Fintrol, Virosin, antimycin A1, 1397-94-0, Caswell No. 052B, Antimycin-A, CCRIS 924, HSDB 6417, EPA Pesticide Chemical Code 006314, 116095-18-2, 75G3NMU1TS, CHEBI:2762, CHEMBL211501, (2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl 3-methylbutanoate, [(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate, CHEBI:22584, 8S75R39Y6J, [(2r,3s,6s,7r,8r)-3-[(3-Formamido-2-Oxidanyl-Phenyl)carbonylamino]-8-Hexyl-2,6-Dimethyl-4,9-Bis(Oxidanylidene)-1,5-Dioxonan-7-Yl] 3-Methylbutanoate, Butanoic acid, 3-methyl-, 3-((3-(formylamino)-2-hydroxybenzoyl)amino)-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl ester, (2R-(2R*,3S*,6S*,7R*,8R*))-, SR-05000002233, UNII-75G3NMU1TS, Antipricullin, Verosin, UNII-8S75R39Y6J, (2R,3S,6S,7R,8R)-3-((3-formamido-2-hydroxybenzoyl)amino)-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl 3-methylbutanoate, AWB, Caswell No 052B, ANTIMYCINS A, ANTIMYCIN A [MI], SCHEMBL218354, DTXSID3058668, DTXSID9032325, UIFFUZWRFRDZJC-SBOOETFBSA-N, AIDS032154, Butanoic acid, 2(or 3)-methyl-, 3-((3-(formylamino)-2-hydroxybenzoyl)amino)-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl ester, BDBM50191588, AKOS015889205, BCP9000305, CCG-208457, FA61700, USEPA/OPP Pesticide Code: 006314, NCGC00017338-02, NCGC00017338-03, NCGC00017338-04, NCGC00017338-05, NCGC00017338-09, NCGC00142516-01, NCGC00142516-02, NCGC00142516-03, HY-107406, CS-0028420, SR-05000002233-2, SR-05000002233-3, [(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxy-benzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate, [3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate, 2(or 3)-Methylbutanoic acid, (2R,3S,6S,7R,8R)-3-[[3-(formylamino)-2-hydroxybenzoyl]amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl ester, 3-Methylbutanoic acid 3-[[3-(formylamino)-2-hydroxybenzoyl]amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl ester, ANTIFUNGAL ANTIBIOTIC PRODUCED BY SEVERAL STREPTOMYCES SPP. CONTAINING MORE THAN 24 COMPONENTS (ANTIMYCINS A1 AND A3 ARE MOST ABUNDANT), BUTANOIC ACID, 3-METHYL-, (2R,3S,6S,7R,8R)-3-((3-(FORMYLAMINO)-2-HYDROXYBENZOYL)AMINO)-8-HEXYL-2,6-DIMETHYL-4,9-DIOXO-1,5-DIOXONAN-7-YL ESTER, isovaleric acid 8-ester with 3-formamido-N-(7-hexyl-8-hydroxy-4,9-dimethyl-2,6-dioxo-1,5-dioxonan-3-yl)salicylamide |
|---|---|
| Topological Polar Surface Area | 157.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Heavy Atom Count | 39.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 849.0 |
| Database Name | cmaup_ingredients;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 5.0 |
| Uniprot Id | O42772, Q54A96, P28272, Q99714, B2RXH2, Q9NUW8, P10636, P00352, P28482, Q03164, P15428, P51450, P08684, P10275, P10828, Q96RI1, Q03181, P03372, P37231, P11473, P04150, Q16236, P04637, Q9R1A7, Q07869, Q9NPD5, Q9Y6L6, O95342, O15438, O15439 |
| Iupac Name | [(2R,3S,6S,7R,8R)-3-[(3-formamido-2-hydroxybenzoyl)amino]-8-hexyl-2,6-dimethyl-4,9-dioxo-1,5-dioxonan-7-yl] 3-methylbutanoate |
| Prediction Hob | 0.0 |
| Target Id | NPT149, NPT48, NPT50, NPT51, NPT94, NPT282, NPT151, NPT109, NPT72, NPT73, NPT713 |
| Xlogp | 5.3 |
| Molecular Formula | C28H40N2O9 |
| Prediction Swissadme | 0.0 |
| Inchi Key | UIFFUZWRFRDZJC-SBOOETFBSA-N |
| Fcsp3 | 0.6071428571428571 |
| Logs | -3.941 |
| Rotatable Bond Count | 12.0 |
| Logd | 2.932 |
| Compound Name | Antimycin A |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 548.273 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 548.273 |
| Hydrogen Bond Acceptor Count | 9.0 |
| Molecular Weight | 548.6 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Esol | -6.582770753846155 |
| Inchi | InChI=1S/C28H40N2O9/c1-6-7-8-9-11-20-25(39-22(32)14-16(2)3)18(5)38-28(36)23(17(4)37-27(20)35)30-26(34)19-12-10-13-21(24(19)33)29-15-31/h10,12-13,15-18,20,23,25,33H,6-9,11,14H2,1-5H3,(H,29,31)(H,30,34)/t17-,18+,20-,23+,25+/m1/s1 |
| Smiles | CCCCCC[C@@H]1[C@H]([C@@H](OC(=O)[C@H]([C@H](OC1=O)C)NC(=O)C2=C(C(=CC=C2)NC=O)O)C)OC(=O)CC(C)C |
| Nring | 2.0 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Aconitum Umbrosum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 2. Outgoing r'ship
FOUND_INto/from Allium Ampeloprasum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 3. Outgoing r'ship
FOUND_INto/from Artemisia Iwayomogi (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 4. Outgoing r'ship
FOUND_INto/from Bolboschoenus Maritimus (Plant) Rel Props:Source_db:npass_chem_all - 5. Outgoing r'ship
FOUND_INto/from Diospyros Chloroxylon (Plant) Rel Props:Source_db:npass_chem_all - 6. Outgoing r'ship
FOUND_INto/from Drimia Altissima (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 7. Outgoing r'ship
FOUND_INto/from Helenium Amarum (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 8. Outgoing r'ship
FOUND_INto/from Narcissus Pseudonarcissus (Plant) Rel Props:Source_db:npass_chem_all - 9. Outgoing r'ship
FOUND_INto/from Scutellaria Viscidula (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 10. Outgoing r'ship
FOUND_INto/from Senecio Retrorsus (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 11. Outgoing r'ship
FOUND_INto/from Taxus Wallichiana (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all