gamma-Pinene
PubChem CID: 149224433
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | gamma-Pinene |
|---|---|
| Topological Polar Surface Area | 0.0 |
| Hydrogen Bond Donor Count | 0.0 |
| Heavy Atom Count | 10.0 |
| Description | Gamma-pinene is also known as G-pinene. Gamma-pinene can be found in dill, which makes gamma-pinene a potential biomarker for the consumption of this food product. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 176.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 2.0 |
| Iupac Name | (1R,5S)-4,6,6-trimethylbicyclo[3.1.1]hept-2-ene |
| Nih Violation | False |
| Class | Prenol lipids |
| Xlogp | 3.3 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Monoterpenoids |
| Molecular Formula | C10H16 |
| Inchi Key | XJBOZKOSICCONT-NPPUSCPJSA-N |
| Rotatable Bond Count | 0.0 |
| Synonyms | g-Pinene, Γ-pinene |
| Compound Name | gamma-Pinene |
| Kingdom | Organic compounds |
| Exact Mass | 136.125 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 136.125 |
| Hydrogen Bond Acceptor Count | 0.0 |
| Molecular Weight | 136.23 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Inchi | InChI=1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h4-5,7-9H,6H2,1-3H3/t7?,8-,9-/m0/s1 |
| Smiles | CC1C=C[C@H]2C[C@@H]1C2(C)C |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | Bicyclic monoterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Anethum Graveolens (Plant) Rel Props:Source_db:fooddb_chem_all