Pterosin N
PubChem CID: 148710
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Pterosin N, 54797-11-4, 2-Hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-2,3-Dihydro-1H-inden-1-one, DTXSID20970135, 1H-Inden-1-one, 2,3-dihydro-2-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-, 2-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-3H-inden-1-one, CHEBI:191606, DTXCID501397673, DB-292170, 2-Hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-1-indanone, 2,3-Dihydro-2-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-1h-inden-1-one, 2,3-Dihydro-2-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-1H-inden-1-one, 9CI |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 57.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CCCCC12 |
| Np Classifier Class | Illudalane sesquiterpenoids |
| Deep Smiles | OCCccC)cccc6C))C=O)CC5)C)O |
| Heavy Atom Count | 17.0 |
| Classyfire Class | Indanes |
| Description | Isolated from Pteridium aquilinum (bracken fern). Pterosin N is found in green vegetables and root vegetables. |
| Scaffold Graph Node Level | OC1CCC2CCCCC12 |
| Classyfire Subclass | Indanones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 315.0 |
| Database Name | fooddb_chem_all;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-3H-inden-1-one |
| Nih Violation | False |
| Class | Indanes |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 1.6 |
| Superclass | Benzenoids |
| Is Pains | False |
| Subclass | Indanones |
| Gsk 4 400 Rule | True |
| Molecular Formula | C14H18O3 |
| Scaffold Graph Node Bond Level | O=C1CCc2ccccc21 |
| Inchi Key | FQLXILLXEWJGFO-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 2.0 |
| State | Solid |
| Synonyms | 2-Hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-1-indanone, 2,3-Dihydro-2-hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-1H-inden-1-one, 9CI, 2,3-dihydro-2-Hydroxy-6-(2-hydroxyethyl)-2,5,7-trimethyl-1H-inden-1-one, 9ci, pterosin n |
| Esol Class | Soluble |
| Functional Groups | CO, cC(C)=O |
| Compound Name | Pterosin N |
| Kingdom | Organic compounds |
| Exact Mass | 234.126 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 234.126 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 234.29 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homopolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C14H18O3/c1-8-6-10-7-14(3,17)13(16)12(10)9(2)11(8)4-5-15/h6,15,17H,4-5,7H2,1-3H3 |
| Smiles | CC1=CC2=C(C(=C1CCO)C)C(=O)C(C2)(C)O |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Indanones |
| Np Classifier Superclass | Sesquiterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Pteridium Aquilinum (Plant) Rel Props:Source_db:npass_chem_all