2,3-Dihydroxypropyl dodecanoate
PubChem CID: 14871
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Monolaurin, 2,3-Dihydroxypropyl dodecanoate, 142-18-7, 1-Monolaurin, Glyceryl monolaurate, Lauricidin, GLYCERYL LAURATE, 27215-38-9, 1-Glyceryl laurate, Glycerol 1-laurate, 1-Monolauroyl-rac-glycerol, 1-Monododecanoylglycerol, Glycerol monolaurate, Laurin, 1-mono-, Glycerin 1-monolaurate, Glycerol 1-monolaurate, Lauric acid 1-monoglyceride, Dodecanoic acid, 2,3-dihydroxypropyl ester, 2,3-Dihydroxypropyl laurate, Glyceryl monododecanoate, 1-Lauroyl-rac-glycerol, .alpha.-monolaurin, 1-monolauroylglycerol, 3-Dodecanoyloxy-1,2-propanediol, (+-)-Glyceryl 1-monododecanoate, Dodecanoic acid alpha-monoglyceride, glyceryl 1-laurate, Glycerin monolaurate, (+-)-2,3-Dihydroxypropyl dodecanoate, 40738-26-9, Dodecanoic acid, monoester with 1,2,3-propanetriol, Glycerol .alpha.-monolaurate, WR963Y5QYW, GLYCEROL MONODODECANOATE, DTXSID5041275, CHEBI:75543, Lauric acid .alpha.-monoglyceride, 1-Monolaurin, 1-Lauroyl-rac-glycerol, Dodecanoic acid .alpha.-monoglyceride, NSC698570, NSC-698570, NCGC00164528-01, alpha-Monolaurin, DL-alpha-Laurin, DTXCID3021275, Glucerol alpha-monolaurate, Monolauroylglycerin, CAS-142-18-7, Lauric acid alpha-monoglyceride, C15H30O4, EINECS 205-526-6, UNII-WR963Y5QYW, Lauricidin R, Cithrol GML, rac-1-monolaurin, MG 12:0, Hodag GML, Glycerox L 8, Lauricidin 802, Lauricidin 812, 1-dodecanoylglycerol, EINECS 266-944-2, Grindtek ML 90, Lauric acid, monoester with glycerol, Dimodan ML 90, Imwitor 312, Sunsoft 750, Sunsoft 757, Monomuls 90L12, Aldo MLD-K-FG, Glycerol 1-dodecanoate, Tegin L 90, rac-1-dodecanoylglycerol, AI3-03482, SDA 16-001-00, rac-1-monolauroylglycerol, Glycerol alpha-monolaurate, Poem M 300, UNII:WR963Y5QYW, EC 205-526-6, EC 266-944-2, Glycerol monolaurate (VAN), Glycerol .alpha.-dodecanoate, SCHEMBL16042, MLS004773952, Glycerol monolaurate, Monolaurin, 2,3-Dihydroxypropyl laurate #, CHEMBL510533, CHEBI:75539, GLYCEROL 1-MONODODECANOATE, 1-Lauroyl-rac-glycerol, >=99%, UNII-Y98611C087, 1,2,3-Propanetriol 1-dodecanoate, MAG 12:0, NSC 4837, rac-2,3-dihydroxypropyl dodecanoate, EINECS 248-337-4, Tox21_112159, Tox21_300759, MFCD00037815, (.+/-.)-Glyceryl 1-monododecanoate, AKOS016005827, Dodecanoic acid,3-dihydroxypropyl ester, FG74771, FM43306, NCGC00164528-02, NCGC00164528-03, NCGC00164528-04, NCGC00254663-01, AS-60593, DA-78785, NCI60_035284, SMR001254002, (+/-)-GLYCERYL 1-MONODODECANOATE, (.+/-.)-2,3-Dihydroxypropyl dodecanoate, HY-121620, G0081, M 300, NS00002792, Y98611C087, (+/-)-2,3-DIHYDROXYPROPYL DODECANOATE, H10813, SBI-0654113.0001, A885218, Q2113676, 1-Monododecanoyl-rac-glycerol, 1-Lauroyl-rac-glycerol, BRD-A10773072-001-03-4, DODECANOIC ACID, 2-HYDROXY-1-(HYDROXYMETHYL) ETHYL ESTER |
|---|---|
| Topological Polar Surface Area | 66.8 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 19.0 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 206.0 |
| Database Name | hmdb_chem_all;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | n.a., P0DTD1 |
| Iupac Name | 2,3-dihydroxypropyl dodecanoate |
| Nih Violation | True |
| Class | Glycerolipids |
| Xlogp | 4.2 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Monoradylglycerols |
| Molecular Formula | C15H30O4 |
| Inchi Key | ARIWANIATODDMH-UHFFFAOYSA-N |
| Rotatable Bond Count | 14.0 |
| Synonyms | 1-Dodecanoylglycerol, 1-Monododecanoylglycerol, 1-Monolaurin, 1-Monomyristin, 2,3-Dihydroxypropyl laurate, Dodecanoic acid alpha-monoglyceride, Dodecanoic acid, 2,3-dihydroxypropyl ester, Glyceryl monolaurate, Lauric acid 1-monoglyceride, Lauricidin, 2,3-Dihydroxypropyl lauric acid, Dodecanoate a-monoglyceride, Dodecanoate alpha-monoglyceride, Dodecanoate α-monoglyceride, Dodecanoic acid a-monoglyceride, Dodecanoic acid α-monoglyceride, Dodecanoate, 2,3-dihydroxypropyl ester, Glyceryl monolauric acid, Laate 1-monoglyceride, Laic acid 1-monoglyceride, 2,3-Dihydroxypropyl dodecanoic acid, 2,3-Dihydroxypropyl laate, 2,3-Dihydroxypropyl laic acid, Glyceryl monolaate, Glyceryl monolaic acid, Glycerol monolaurate, 1-Dodecylglycerol, Monododecylglycerol, Monoglycerol laurate, Monolaurin, 1-O-Dodecylglycerol, rac-sn-1(3)-Dodecylglycerol |
| Compound Name | 2,3-Dihydroxypropyl dodecanoate |
| Kingdom | Organic compounds |
| Exact Mass | 274.214 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 274.214 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 274.4 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Inchi | InChI=1S/C15H30O4/c1-2-3-4-5-6-7-8-9-10-11-15(18)19-13-14(17)12-16/h14,16-17H,2-13H2,1H3 |
| Smiles | CCCCCCCCCCCC(=O)OCC(CO)O |
| Defined Bond Stereocenter Count | 0.0 |
| Taxonomy Direct Parent | 1-monoacylglycerols |
- 1. Outgoing r'ship
FOUND_INto/from Serenoa Repens (Plant) Rel Props:Source_db:npass_chem_all