Gibberellin A30
PubChem CID: 14833709
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Gibberellin A30, 2beta,4aalpha,6alpha-Trihydroxy-1beta-methyl-8-methylenegibb-3-ene-1alpha,10beta-dicarboxylic acid 1,4a-lactone |
|---|---|
| Topological Polar Surface Area | 104.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | XRIRDTGIFOWQDB-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | GA30, Gibberellin A30 |
| Heavy Atom Count | 25.0 |
| Compound Name | Gibberellin A30 |
| Description | Gibberellin a30 is a member of the class of compounds known as c19-gibberellin 6-carboxylic acids. C19-gibberellin 6-carboxylic acids are c19-gibberellins with a carboxyl group at the 6-position. Gibberellin a30 is slightly soluble (in water) and a weakly acidic compound (based on its pKa). Gibberellin a30 can be found in peach and sour cherry, which makes gibberellin a30 a potential biomarker for the consumption of these food products. |
| Exact Mass | 346.142 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 346.142 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 757.0 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 346.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 4,12-dihydroxy-11-methyl-6-methylidene-16-oxo-15-oxapentacyclo[9.3.2.15,8.01,10.02,8]heptadec-13-ene-9-carboxylic acid |
| Total Atom Stereocenter Count | 9.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C19H22O6/c1-8-6-18-7-9(8)10(20)5-11(18)19-4-3-12(21)17(2,16(24)25-19)14(19)13(18)15(22)23/h3-4,9-14,20-21H,1,5-7H2,2H3,(H,22,23) |
| Smiles | CC12C(C=CC3(C1C(C45C3CC(C(C4)C(=C)C5)O)C(=O)O)OC2=O)O |
| Xlogp | 0.3 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C19H22O6 |
- 1. Outgoing r'ship
FOUND_INto/from Prunus Cerasus (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Prunus Persica (Plant) Rel Props:Source_db:fooddb_chem_all