Kaempferol 3-alpha-D-arabinopyranoside
PubChem CID: 14749098
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Kaempferol 3-alpha-D-arabinopyranoside |
|---|---|
| Topological Polar Surface Area | 166.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | RNVUDWOQYYWXBJ-ZMQFRBSTSA-N |
| Rotatable Bond Count | 3.0 |
| Heavy Atom Count | 30.0 |
| Compound Name | Kaempferol 3-alpha-D-arabinopyranoside |
| Description | Kaempferol 3-alpha-d-arabinopyranoside is a member of the class of compounds known as flavonoid-3-o-glycosides. Flavonoid-3-o-glycosides are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position. Kaempferol 3-alpha-d-arabinopyranoside is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Kaempferol 3-alpha-d-arabinopyranoside can be found in avocado, which makes kaempferol 3-alpha-d-arabinopyranoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 418.09 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 418.09 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 672.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 418.3 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | 5,7-dihydroxy-2-(4-hydroxyphenyl)-3-[(2S,3S,4S,5R)-3,4,5-trihydroxyoxan-2-yl]oxychromen-4-one |
| Total Atom Stereocenter Count | 4.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C20H18O10/c21-9-3-1-8(2-4-9)18-19(30-20-17(27)15(25)12(24)7-28-20)16(26)14-11(23)5-10(22)6-13(14)29-18/h1-6,12,15,17,20-25,27H,7H2/t12-,15+,17+,20+/m1/s1 |
| Smiles | C1[C@H]([C@@H]([C@@H]([C@@H](O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)O)O |
| Xlogp | 0.8 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C20H18O10 |
- 1. Outgoing r'ship
FOUND_INto/from Persea Americana (Plant) Rel Props:Source_db:fooddb_chem_all