2,6-Dimethoxy-3-methyl-9H-carbazole
PubChem CID: 147297
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Glycozolidine, 2,6-Dimethoxy-3-methyl-9H-carbazole, 29093-41-2, 9H-Carbazole, 2,6-dimethoxy-3-methyl-, CHEMBL463555, SCHEMBL15203441, 2,6-dimethoxy-3-methylcarbazole, DTXSID70183339 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 34.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCC2C(C1)CC1CCCCC12 |
| Np Classifier Class | Carbazole alkaloids |
| Deep Smiles | COcccccc6)cccC)ccc6[nH]9)))OC |
| Heavy Atom Count | 18.0 |
| Classyfire Class | Indoles and derivatives |
| Scaffold Graph Node Level | C1CCC2C(C1)NC1CCCCC12 |
| Classyfire Subclass | Carbazoles |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 296.0 |
| Database Name | imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,6-dimethoxy-3-methyl-9H-carbazole |
| Veber Rule | True |
| Classyfire Superclass | Organoheterocyclic compounds |
| Xlogp | 3.7 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C15H15NO2 |
| Scaffold Graph Node Bond Level | c1ccc2c(c1)[nH]c1ccccc12 |
| Inchi Key | MKQKWPIESXSKSS-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 2.0 |
| Synonyms | glycozolidine |
| Esol Class | Moderately soluble |
| Functional Groups | cOC, c[nH]c |
| Compound Name | 2,6-Dimethoxy-3-methyl-9H-carbazole |
| Exact Mass | 241.11 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 241.11 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 241.28 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C15H15NO2/c1-9-6-11-12-7-10(17-2)4-5-13(12)16-14(11)8-15(9)18-3/h4-8,16H,1-3H3 |
| Smiles | CC1=CC2=C(C=C1OC)NC3=C2C=C(C=C3)OC |
| Np Classifier Biosynthetic Pathway | Alkaloids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Tryptophan alkaloids |
- 1. Outgoing r'ship
FOUND_INto/from Brugmansia Arborea (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Callicarpa Arborea (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Careya Arborea (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Datura Arborea (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Erica Arborea (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Glycosmis Chlorosperma (Plant) Rel Props:Reference: - 7. Outgoing r'ship
FOUND_INto/from Glycosmis Cochinchinensis (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Glycosmis Macrocarpa (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Glycosmis Macrophylla (Plant) Rel Props:Reference: - 10. Outgoing r'ship
FOUND_INto/from Glycosmis Mauritiana (Plant) Rel Props:Reference:ISBN:9770972795006; ISBN:9788172360481; ISBN:9788185042114 - 11. Outgoing r'ship
FOUND_INto/from Glycosmis Montana (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Glycosmis Ovoidea (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Glycosmis Parviflora (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Glycosmis Pentaphylla (Plant) Rel Props:Reference:ISBN:9788185042084 - 15. Outgoing r'ship
FOUND_INto/from Glycosmis Pseudoracemosa (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Glycosmis Puberula (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Glycosmis Stenocarpa (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Gmelina Arborea (Plant) Rel Props:Reference: - 19. Outgoing r'ship
FOUND_INto/from Harpullia Arborea (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Hortia Arborea (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Mastixia Arborea (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Myrica Arborea (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Reissantia Arborea (Plant) Rel Props:Reference: - 24. Outgoing r'ship
FOUND_INto/from Sorbaria Arborea (Plant) Rel Props:Reference: - 25. Outgoing r'ship
FOUND_INto/from Vernonia Arborea (Plant) Rel Props:Reference: - 26. Outgoing r'ship
FOUND_INto/from Wrightia Arborea (Plant) Rel Props:Reference: