Ixoric acid
PubChem CID: 14583652
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Ixoric acid, 8Z,10Z,12Z,14E-octadecatetraenoic acid, Ixate, Ixic acid, LMFA02000296, Q54914843, (8Z,10Z,12Z,14E)-octadeca-8,10,12,14-tetraenoic acid |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 37.3 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Other Octadecanoids, Unsaturated fatty acids |
| Deep Smiles | CCC/C=C/C=CC=C/C=CCCCCCCC=O)O |
| Heavy Atom Count | 20.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Lineolic acids and derivatives |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 335.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (8Z,10Z,12Z,14E)-octadeca-8,10,12,14-tetraenoic acid |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 5.9 |
| Gsk 4 400 Rule | False |
| Molecular Formula | C18H28O2 |
| Inchi Key | FCQPVKRMQXBSAO-GGBIPKAMSA-N |
| Silicos It Class | Poorly soluble |
| Rotatable Bond Count | 12.0 |
| Synonyms | ixoric acid |
| Esol Class | Moderately soluble |
| Functional Groups | C/C=CC=C/C=CC=CC, CC(=O)O |
| Compound Name | Ixoric acid |
| Exact Mass | 276.209 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 276.209 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 276.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 4.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h4-11H,2-3,12-17H2,1H3,(H,19,20)/b5-4+,7-6-,9-8-,11-10- |
| Smiles | CCC/C=C/C=C\C=C/C=C\CCCCCCC(=O)O |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 4.0 |
| Egan Rule | True |
| Np Classifier Superclass | Fatty Acids and Conjugates, Octadecanoids |
- 1. Outgoing r'ship
FOUND_INto/from Ixora Chinensis (Plant) Rel Props:Reference:ISBN:9788172362300