2-O-Methylxylose
PubChem CID: 14536300
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-o-methylxylose, 2-Methylxyloside, 2-O-Methyl-d-xylose, D-Xylose, 2-O-methyl-, Xylose, 2-O-methyl-, D-, K40894DQHT, 7434-28-8, UNII-K40894DQHT, (2R,3S,4R)-3,4,5-trihydroxy-2-methoxypentanal, SCHEMBL616881, CHEBI:173727, DTXSID001316634, Q27281925 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 87.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Np Classifier Class | Monosaccharides |
| Deep Smiles | CO[C@H][C@H][C@@H]CO))O))O))C=O |
| Heavy Atom Count | 11.0 |
| Classyfire Class | Organooxygen compounds |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 116.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 3.0 |
| Iupac Name | (2R,3S,4R)-3,4,5-trihydroxy-2-methoxypentanal |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -1.8 |
| Gsk 4 400 Rule | True |
| Molecular Formula | C6H12O5 |
| Inchi Key | ALNDFFUAQIVVPG-SRQIZXRXSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 5.0 |
| Synonyms | 2-o-methylxylose, d-2-o-methylxylose |
| Esol Class | Highly soluble |
| Functional Groups | CC=O, CO, COC |
| Compound Name | 2-O-Methylxylose |
| Exact Mass | 164.068 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 164.068 |
| Hydrogen Bond Acceptor Count | 5.0 |
| Molecular Weight | 164.16 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C6H12O5/c1-11-5(3-8)6(10)4(9)2-7/h3-7,9-10H,2H2,1H3/t4-,5+,6+/m1/s1 |
| Smiles | CO[C@@H](C=O)[C@H]([C@@H](CO)O)O |
| Np Classifier Biosynthetic Pathway | Carbohydrates |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Saccharides |
- 1. Outgoing r'ship
FOUND_INto/from Phoenix Dactylifera (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279 - 2. Outgoing r'ship
FOUND_INto/from Prunus Domestica (Plant) Rel Props:Reference:https://doi.org/10.2174/0929867033456729