Momordicinin
PubChem CID: 14526924
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Momordicinin, SCHEMBL21264287, CHEBI:190390, BDBM604155, 13b,28-Epoxy-11-ursen-3-one, US11660306, Example Momordicinin, 4,5,9,9,13,19,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-one |
|---|---|
| Topological Polar Surface Area | 26.3 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | PKMBOLUTQNQQBP-UHFFFAOYSA-N |
| Rotatable Bond Count | 0.0 |
| Synonyms | 13b,28-Epoxy-11-ursen-3-one, Momordicinin |
| Heavy Atom Count | 32.0 |
| Compound Name | Momordicinin |
| Description | Constituent of Momordica charantia (bitter melon). Momordicinin is found in bitter gourd and fruits. |
| Exact Mass | 438.35 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 438.35 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 887.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 438.7 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 4,5,9,9,13,19,20-heptamethyl-24-oxahexacyclo[15.5.2.01,18.04,17.05,14.08,13]tetracos-15-en-10-one |
| Total Atom Stereocenter Count | 10.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C30H46O2/c1-19-8-14-29-17-16-28(7)27(6)13-9-21-25(3,4)23(31)11-12-26(21,5)22(27)10-15-30(28,32-18-29)24(29)20(19)2/h10,15,19-22,24H,8-9,11-14,16-18H2,1-7H3 |
| Smiles | CC1CCC23CCC4(C5(CCC6C(C(=O)CCC6(C5C=CC4(C2C1C)OC3)C)(C)C)C)C |
| Xlogp | 7.1 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C30H46O2 |
- 1. Outgoing r'ship
FOUND_INto/from Momordica Charantia (Plant) Rel Props:Source_db:fooddb_chem_all