Myricetin 3-arabinofuranoside
PubChem CID: 14524429
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Betmidin, Myricetin 3-arabinofuranoside, 3-(3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl)oxy-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one, 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one, Myricetin 3-O-arabinoside, DTXSID101341597, 1198767-93-9 |
|---|---|
| Prediction Swissadme | 0.0 |
| Topological Polar Surface Area | 207.0 |
| Hydrogen Bond Donor Count | 8.0 |
| Inchi Key | OXJKSVCEIOYZQL-UHFFFAOYSA-N |
| Fcsp3 | 0.25 |
| Rotatable Bond Count | 4.0 |
| Synonyms | 3,3',4',5,5',7-Hexahydroxyflavone 3-O-a-L-arabinofuranoside, Betmidin, Myricetin 3-arabinofuranoside, Myricetin 3-O-a-L-arabinofuranoside |
| Heavy Atom Count | 32.0 |
| Compound Name | Myricetin 3-arabinofuranoside |
| Description | Myricetin 3-arabinofuranoside is a member of the class of compounds known as flavonoid-3-o-glycosides. Flavonoid-3-o-glycosides are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C3-position. Myricetin 3-arabinofuranoside is slightly soluble (in water) and a very weakly acidic compound (based on its pKa). Myricetin 3-arabinofuranoside can be found in american cranberry, black chokeberry, highbush blueberry, and lingonberry, which makes myricetin 3-arabinofuranoside a potential biomarker for the consumption of these food products. |
| Prediction Hob Swissadme | 0.0 |
| Exact Mass | 450.08 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 450.08 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 730.0 |
| Hydrogen Bond Acceptor Count | 12.0 |
| Molecular Weight | 450.3 |
| Database Name | cmaup_ingredients;fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)chromen-4-one |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Prediction Hob | 0.0 |
| Esol | -2.763382400000001 |
| Inchi | InChI=1S/C20H18O12/c21-5-12-15(27)17(29)20(31-12)32-19-16(28)13-8(23)3-7(22)4-11(13)30-18(19)6-1-9(24)14(26)10(25)2-6/h1-4,12,15,17,20-27,29H,5H2 |
| Smiles | C1=C(C=C(C(=C1O)O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(O4)CO)O)O |
| Xlogp | 0.6 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C20H18O12 |
- 1. Outgoing r'ship
FOUND_INto/from Vaccinium Macrocarpon (Plant) Rel Props:Source_db:cmaup_ingredients