4-Methyl-7-(1-methylethenyl)-3,8-dioxatricyclo[5.1.0.02,4]octane
PubChem CID: 14414154
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 1,2:3,4-Diepoxy-p-menth-8-ene, 120749-18-0, 4-Methyl-7-(1-methylethenyl)-3,8-dioxatricyclo[5.1.0.02,4]octane, 4-Methyl-7-(1-methylethenyl)-3,8-dioxatricyclo(5.1.0.02,4)octane, CHEBI:195776, DTXSID001169978, 1,2:3,4-Bisepoxy-p-menth-8-ene, 4-methyl-7-prop-1-en-2-yl-3,8-dioxatricyclo[5.1.0.02,4]octane |
|---|---|
| Topological Polar Surface Area | 25.1 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | CJWLGOWMMDDXLV-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | 1,2:3,4-Bisepoxy-p-menth-8-ene |
| Heavy Atom Count | 12.0 |
| Compound Name | 4-Methyl-7-(1-methylethenyl)-3,8-dioxatricyclo[5.1.0.02,4]octane |
| Description | Constituent of parsley leaves (Petroselinum crispum). 1,2:3,4-Diepoxy-p-menth-8-ene is found in herbs and spices and parsley. |
| Exact Mass | 166.099 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 166.099 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 273.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 166.22 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 4-methyl-7-prop-1-en-2-yl-3,8-dioxatricyclo[5.1.0.02,4]octane |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C10H14O2/c1-6(2)10-5-4-9(3)7(11-9)8(10)12-10/h7-8H,1,4-5H2,2-3H3 |
| Smiles | CC(=C)C12CCC3(C(C1O2)O3)C |
| Xlogp | 1.5 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C10H14O2 |
- 1. Outgoing r'ship
FOUND_INto/from Petroselinum Crispum (Plant) Rel Props:Source_db:fooddb_chem_all