Isorhamnetin7-O-alpha-L-rhamnoside
PubChem CID: 14310828
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Isorhamnetin7-O-alpha-L-rhamnoside |
|---|---|
| Topological Polar Surface Area | 175.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | XLQFMBLUUSGXQY-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| Synonyms | Isorhamnetin 7-rhamnoside |
| Heavy Atom Count | 33.0 |
| Compound Name | Isorhamnetin7-O-alpha-L-rhamnoside |
| Description | Isorhamnetin 7-rhamnoside is a member of the class of compounds known as flavonoid-7-o-glycosides. Flavonoid-7-o-glycosides are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to carbohydrate moiety at the C7-position. Isorhamnetin 7-rhamnoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Isorhamnetin 7-rhamnoside can be found in sea-buckthornberry, which makes isorhamnetin 7-rhamnoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 462.116 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 462.116 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 757.0 |
| Hydrogen Bond Acceptor Count | 11.0 |
| Molecular Weight | 462.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3,5-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-7-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxychromen-4-one |
| Total Atom Stereocenter Count | 5.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C22H22O11/c1-8-16(25)18(27)20(29)22(31-8)32-10-6-12(24)15-14(7-10)33-21(19(28)17(15)26)9-3-4-11(23)13(5-9)30-2/h3-8,16,18,20,22-25,27-29H,1-2H3 |
| Smiles | CC1C(C(C(C(O1)OC2=CC(=C3C(=C2)OC(=C(C3=O)O)C4=CC(=C(C=C4)O)OC)O)O)O)O |
| Xlogp | 1.2 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C22H22O11 |
- 1. Outgoing r'ship
FOUND_INto/from Hippophae Rhamnoides (Plant) Rel Props:Source_db:fooddb_chem_all