6-Ethyl-2-picoline
PubChem CID: 14287
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2-ETHYL-6-METHYLPYRIDINE, 1122-69-6, 2-Methyl-6-ethylpyridine, Pyridine, 2-ethyl-6-methyl-, 2-Picoline, 6-ethyl-, 6-Ethyl-2-picoline, 6-Ethyl-2-methylpyridine, YPG7D02E36, EINECS 214-356-1, MFCD00023531, 6-METHYL-2-ETHYLPYRIDINE, DTXSID70149950, 2-ethyl-6-methyl-pyridine, 2-Ethyl-6-methylpyridine (2-Ethyl-6-picoline), UNII-YPG7D02E36, SCHEMBL91367, DTXCID4072441, AKOS015967580, FE55042, SB53310, s10152, 2-Ethyl-6-picoline, 6-Ethyl-2-picoline, CS-12301, SY046027, DB-041067, CS-0217858, NS00023619, EN300-90378, Q63399568, Z1255485781, 214-356-1 |
|---|---|
| Topological Polar Surface Area | 12.9 |
| Hydrogen Bond Donor Count | 0.0 |
| Inchi Key | SFSXNVBMAODLGN-UHFFFAOYSA-N |
| Rotatable Bond Count | 1.0 |
| Synonyms | 2-Ethyl-6-methylpyridine, 2-Methyl-6-ethylpyridine, 2-Picoline, 6-ethyl-, 6-Ethyl-2-methylpyridine, 6-Ethyl-2-picoline, Pyridine, 2-ethyl-6-methyl- |
| Heavy Atom Count | 9.0 |
| Compound Name | 6-Ethyl-2-picoline |
| Description | 2-methyl-6-ethylpyridine is a member of the class of compounds known as methylpyridines. Methylpyridines are organic compounds containing a pyridine ring substituted at one or more positions by a methyl group. 2-methyl-6-ethylpyridine is soluble (in water) and a very strong basic compound (based on its pKa). 2-methyl-6-ethylpyridine can be found in tea, which makes 2-methyl-6-ethylpyridine a potential biomarker for the consumption of this food product. |
| Exact Mass | 121.089 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 121.089 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 80.6 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 121.18 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-ethyl-6-methylpyridine |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C8H11N/c1-3-8-6-4-5-7(2)9-8/h4-6H,3H2,1-2H3 |
| Smiles | CCC1=CC=CC(=N1)C |
| Xlogp | 2.1 |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C8H11N |
- 1. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all