Dodecanamide
PubChem CID: 14256
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | DODECANAMIDE, Lauramide, 1120-16-7, Dodecylamide, Lauric amide, Lauryl amide, Amide KK, Dodecamide, Lauroylamide, Lauric acid amide, Dodecanoic acid amide, n-dodecanamide, NSC 889, Diamide Y, EINECS 214-298-7, NSC 26630, UNII-3BD22052MO, NSC-889, 3BD22052MO, NSC-26630, DTXSID5022146, CHEBI:34726, Dodecylacid amide, MFCD00025532, LAURAMIDE [INCI], SCHEMBL42192, DTXCID002146, NSC889, SCHEMBL11355406, NSC26630, LMFA08010001, AKOS006228958, FS-4114, DB-041030, CS-0206349, L0077, NS00013810, D91239, Q27116246, 214-298-7 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 43.1 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Np Classifier Class | Primary amides |
| Deep Smiles | CCCCCCCCCCCC=O)N |
| Heavy Atom Count | 14.0 |
| Classyfire Class | Fatty acyls |
| Classyfire Subclass | Fatty amides |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 134.0 |
| Database Name | hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P19021 |
| Iupac Name | dodecanamide |
| Nih Violation | True |
| Class | Fatty Acyls |
| Veber Rule | True |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 3.5 |
| Superclass | Lipids and lipid-like molecules |
| Is Pains | False |
| Subclass | Fatty amides |
| Gsk 4 400 Rule | True |
| Molecular Formula | C12H25NO |
| Inchi Key | ILRSCQWREDREME-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 10.0 |
| Synonyms | Lauramide, dodecanamide |
| Esol Class | Soluble |
| Functional Groups | CC(N)=O |
| Compound Name | Dodecanamide |
| Kingdom | Organic compounds |
| Exact Mass | 199.194 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 199.194 |
| Hydrogen Bond Acceptor Count | 1.0 |
| Molecular Weight | 199.33 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aliphatic acyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C12H25NO/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H2,13,14) |
| Smiles | CCCCCCCCCCCC(=O)N |
| Np Classifier Biosynthetic Pathway | Fatty acids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Fatty amides |
| Np Classifier Superclass | Fatty amides |
- 1. Outgoing r'ship
FOUND_INto/from Cirsium Japonicum (Plant) Rel Props:Reference:https://doi.org/10.1080/10412905.2005.9698816