g-Glu-Ile
PubChem CID: 14253342
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | g-Glu-Ile, SCHEMBL236277 |
|---|---|
| Topological Polar Surface Area | 130.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Heavy Atom Count | 18.0 |
| Description | Constituent of onion Allium cepa and mung bean (Vigna radiata). N-gamma-L-Glutamyl-L-isoleucine is found in many foods, some of which are garden onion, soft-necked garlic, pulses, and onion-family vegetables. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 319.0 |
| Database Name | fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[(4-amino-4-carboxybutanoyl)amino]-3-methylpentanoic acid |
| Nih Violation | False |
| Class | Carboxylic acids and derivatives |
| Xlogp | -3.5 |
| Superclass | Organic acids and derivatives |
| Is Pains | False |
| Subclass | Amino acids, peptides, and analogues |
| Molecular Formula | C11H20N2O5 |
| Inchi Key | SNCKGJWJABDZHI-UHFFFAOYSA-N |
| Rotatable Bond Count | 8.0 |
| State | Solid |
| Synonyms | g-Glu-ile, gamma-Glu-ile, gamma-Glutamylisoleucine |
| Substituent Name | N-acyl-aliphatic-alpha amino acid, Alpha-amino acid, Methyl-branched fatty acid, Branched fatty acid, Amino fatty acid, Fatty acyl, Fatty acid, Dicarboxylic acid or derivatives, Organic 1,3-dipolar compound, Propargyl-type 1,3-dipolar organic compound, Carboxylic acid, Carboximidic acid derivative, Carboximidic acid, Hydrocarbon derivative, Primary amine, Organooxygen compound, Organonitrogen compound, Primary aliphatic amine, Carbonyl group, Amine, Aliphatic acyclic compound |
| Compound Name | g-Glu-Ile |
| Kingdom | Organic compounds |
| Exact Mass | 260.137 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 260.137 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 260.29 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 3.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C11H20N2O5/c1-3-6(2)9(11(17)18)13-8(14)5-4-7(12)10(15)16/h6-7,9H,3-5,12H2,1-2H3,(H,13,14)(H,15,16)(H,17,18) |
| Smiles | CCC(C)C(C(=O)O)NC(=O)CCC(C(=O)O)N |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Allium Cepa (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:fooddb_chem_all