Quercetin 3-(2-glucosylrhamnoside)
PubChem CID: 14238625
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Quercetin 3-(2-glucosylrhamnoside), Quercetin 3-glucosyl-(1->2)-rhamnoside, 3-[4,5-dihydroxy-6-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one, CHEBI:185492, Flavonol base + 4O, O-dHex-Hex, D85018, [QUERCETIN-3-O-D-GLUCOSYL]-(1-2)-L-RHAMNOSIDE, Quercetin 3-O-[2''-O-b-D-glucopyranosyl]-a-L-rhamnopyranoside |
|---|---|
| Topological Polar Surface Area | 266.0 |
| Hydrogen Bond Donor Count | 10.0 |
| Inchi Key | DFNXNCCYQRPZMD-UHFFFAOYSA-N |
| Rotatable Bond Count | 6.0 |
| Synonyms | Quercetin 3-(2-glucosylrhamnoside), Quercetin 3-glucosyl-(1->2)-rhamnoside |
| Heavy Atom Count | 43.0 |
| Compound Name | Quercetin 3-(2-glucosylrhamnoside) |
| Description | Isolated from Ginkgo biloba (ginkgo). Quercetin 3-(2-glucosylrhamnoside) is found in ginkgo nuts and fats and oils. |
| Exact Mass | 610.153 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 610.153 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1020.0 |
| Hydrogen Bond Acceptor Count | 16.0 |
| Molecular Weight | 610.5 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-[4,5-dihydroxy-6-methyl-3-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| Total Atom Stereocenter Count | 10.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C27H30O16/c1-8-17(33)21(37)25(43-26-22(38)20(36)18(34)15(7-28)41-26)27(39-8)42-24-19(35)16-13(32)5-10(29)6-14(16)40-23(24)9-2-3-11(30)12(31)4-9/h2-6,8,15,17-18,20-22,25-34,36-38H,7H2,1H3 |
| Smiles | CC1C(C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC(=C(C=C4)O)O)OC5C(C(C(C(O5)CO)O)O)O)O)O |
| Xlogp | -0.7 |
| Is Pains | True |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C27H30O16 |
- 1. Outgoing r'ship
FOUND_INto/from Ginkgo Biloba (Plant) Rel Props:Source_db:fooddb_chem_all