Urate Oxidase
PubChem CID: 14228836
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Oxidase, urate, 9002-12-4, azane, [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate, Urate Oxidase, Uricase from Bacillus fastidiosus, Urate:oxygen oxidoreductase, URATE OXIDASE [WHO-DD], Uricase from Bacillus fastidiosus, lyophilized, ~9 U/mg, Uricase from Arthrobacter globiformis, lyophilized powder, 15-30 units/mg protein (biuret), 232-655-5, Uricase from Candida sp., recombinant, expressed in E. coli, lyophilized powder, >=2 units/mg solid |
|---|---|
| Topological Polar Surface Area | 255.0 |
| Hydrogen Bond Donor Count | 8.0 |
| Inchi Key | VPXDHZMLJOJKOX-UHFFFAOYSA-N |
| Rotatable Bond Count | 8.0 |
| Synonyms | Aspergilus urate oxidase, Rasburicase, Urate oxidase, Urate: oxygen oxoreductase, Urate:O2 oxidoreductase, Uricase bacillus fastidiosus, Uricase from arthrobacter globiformis, Uricase from candida SP. |
| Heavy Atom Count | 38.0 |
| Compound Name | Urate Oxidase |
| Description | Uricase is also known as oxidase, urate or urate oxidase. Uricase can be found in soy bean, which makes uricase a potential biomarker for the consumption of this food product. The enzyme urate oxidase (UO), or uricase or factor-independent urate hydroxylase, absent in humans, catalyzes the oxidation of uric acid to 5-hydroxyisourate: Uric acid + O2 + H2O → 5-hydroxyisourate + H2O2 5-hydroxyisourate + H2O → allantoin + CO2 . |
| Exact Mass | 567.121 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 567.121 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1070.0 |
| Hydrogen Bond Acceptor Count | 15.0 |
| Molecular Weight | 567.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 2.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | azane, [5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [5-(2,4-dioxopyrimidin-1-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl] hydrogen phosphate |
| Total Atom Stereocenter Count | 8.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C18H23N4O14P.H3N/c23-5-7-14(13(28)16(34-7)22-4-2-10(25)20-18(22)30)36-37(31,32)33-6-8-11(26)12(27)15(35-8)21-3-1-9(24)19-17(21)29, /h1-4,7-8,11-16,23,26-28H,5-6H2,(H,31,32)(H,19,24,29)(H,20,25,30), 1H3 |
| Smiles | C1=CN(C(=O)NC1=O)C2C(C(C(O2)COP(=O)(O)OC3C(OC(C3O)N4C=CC(=O)NC4=O)CO)O)O.N |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C18H26N5O14P |
- 1. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all