7-Hydroxycostol
PubChem CID: 14165818
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 7-Hydroxycostol, CHEBI:173709, [2S-(2alpha,4abeta,8aalpha)]-Decahydro-2-hydroxy-4a-methyl-b,8-bis(methylene)-2-naphthaleneethanol, 2-(3-hydroxyprop-1-en-2-yl)-4a-methyl-8-methylidene-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ol |
|---|---|
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | SDWGOFYIBUYAQT-UHFFFAOYSA-N |
| Rotatable Bond Count | 2.0 |
| Synonyms | (+)-7-Hydroxycostol, [2S-(2alpha,4abeta,8aalpha)]-Decahydro-2-hydroxy-4a-methyl-b,8-bis(methylene)-2-naphthaleneethanol, 7-Hydroxycostol, Petrovin B, Petrovin b, [2S-(2alpha,4Abeta,8aalpha)]-decahydro-2-hydroxy-4a-methyl-b,8-bis(methylene)-2-naphthaleneethanol |
| Heavy Atom Count | 17.0 |
| Compound Name | 7-Hydroxycostol |
| Kingdom | Organic compounds |
| Description | Phytoalexin from Ipomoea batatas (sweet potato) infected with Ceratocystis fimbriata. 7-Hydroxycostol is found in sweet potato, root vegetables, and potato. |
| Exact Mass | 236.178 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 236.178 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 347.0 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 236.35 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-(3-hydroxyprop-1-en-2-yl)-4a-methyl-8-methylidene-3,4,5,6,7,8a-hexahydro-1H-naphthalen-2-ol |
| Total Atom Stereocenter Count | 3.0 |
| Molecular Framework | Aliphatic homopolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Prenol lipids |
| Inchi | InChI=1S/C15H24O2/c1-11-5-4-6-14(3)7-8-15(17,9-13(11)14)12(2)10-16/h13,16-17H,1-2,4-10H2,3H3 |
| Smiles | CC12CCCC(=C)C1CC(CC2)(C(=C)CO)O |
| Xlogp | 3.1 |
| Superclass | Lipids and lipid-like molecules |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Sesquiterpenoids |
| Taxonomy Direct Parent | Eudesmane, isoeudesmane or cycloeudesmane sesquiterpenoids |
| Molecular Formula | C15H24O2 |
- 1. Outgoing r'ship
FOUND_INto/from Ipomoea Batatas (Plant) Rel Props:Source_db:fooddb_chem_all