Gibberellin A65
PubChem CID: 14160539
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Gibberellin A65, CHEBI:175650, 8-ormyl-14-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
|---|---|
| Topological Polar Surface Area | 112.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Inchi Key | XIYAYYIGCSWTQO-UHFFFAOYSA-N |
| Rotatable Bond Count | 3.0 |
| Synonyms | GA65, Gibberellin A65 |
| Heavy Atom Count | 26.0 |
| Compound Name | Gibberellin A65 |
| Description | Isolated from seeds of Helianthus annuus (sunflower). Gibberellin A65 is found in sunflower and fats and oils. |
| Exact Mass | 362.173 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 362.173 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 715.0 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 362.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 8-formyl-14-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylic acid |
| Total Atom Stereocenter Count | 8.0 |
| Nih Violation | True |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C20H26O6/c1-10-11-4-5-12-19(9-21)7-3-6-18(2,17(25)26)14(19)13(16(23)24)20(12,8-11)15(10)22/h9,11-15,22H,1,3-8H2,2H3,(H,23,24)(H,25,26) |
| Smiles | CC1(CCCC2(C1C(C34C2CCC(C3)C(=C)C4O)C(=O)O)C=O)C(=O)O |
| Xlogp | 1.0 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C20H26O6 |
- 1. Outgoing r'ship
FOUND_INto/from Helianthus Annuus (Plant) Rel Props:Source_db:fooddb_chem_all