Hydroxytyrosol 4'-O-glucoside
PubChem CID: 14158111
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Hydroxytyrosol 4'-O-glucoside, ECA69580 |
|---|---|
| Topological Polar Surface Area | 140.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | JVOQYXVFJHETKK-UHFFFAOYSA-N |
| Rotatable Bond Count | 5.0 |
| Synonyms | 2-(3,4-Dihydroxyphenyl)ethanol, 4'-O-b-D-Glucopyranoside, Decoumaroylibotanolide, Hydroxytyrosol 4'-glucoside, Hydroxytyrosol 4'-O-glucopyranoside, Hydroxytyrosol 4'-O-glucoside |
| Heavy Atom Count | 22.0 |
| Compound Name | Hydroxytyrosol 4'-O-glucoside |
| Description | Hydroxytyrosol 4'-o-glucoside is a member of the class of compounds known as phenolic glycosides. Phenolic glycosides are organic compounds containing a phenolic structure attached to a glycosyl moiety. Some examples of phenolic structures include lignans, and flavonoids. Among the sugar units found in natural glycosides are D-glucose, L-Fructose, and L rhamnose. Hydroxytyrosol 4'-o-glucoside is soluble (in water) and a very weakly acidic compound (based on its pKa). Hydroxytyrosol 4'-o-glucoside can be found in olive, which makes hydroxytyrosol 4'-o-glucoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 316.116 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 316.116 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 341.0 |
| Hydrogen Bond Acceptor Count | 8.0 |
| Molecular Weight | 316.3 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-[2-hydroxy-4-(2-hydroxyethyl)phenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Total Atom Stereocenter Count | 5.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C14H20O8/c15-4-3-7-1-2-9(8(17)5-7)21-14-13(20)12(19)11(18)10(6-16)22-14/h1-2,5,10-20H,3-4,6H2 |
| Smiles | C1=CC(=C(C=C1CCO)O)OC2C(C(C(C(O2)CO)O)O)O |
| Xlogp | -1.3 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C14H20O8 |
- 1. Outgoing r'ship
FOUND_INto/from Olea Europaea (Plant) Rel Props:Source_db:fooddb_chem_all