Gravelliferone
PubChem CID: 14133589
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Gravelliferone, 21316-80-3, CHEMBL5177258, 7-hydroxy-3-(2-methylbut-3-en-2-yl)-6-(3-methylbut-2-enyl)chromen-2-one, 2H-1-Benzopyran-2-one, 3-(1,1-dimethyl-2-propen-1-yl)-7-hydroxy-6-(3-methyl-2-buten-1-yl)-, Gravelliferone methyl ether, DTXSID90556369, CHEBI:174840, BDBM50591783, AKOS040735342, NS00094854, 3-(1,1-Dimethylallyl)-7-hydroxy-6-(3-methyl-2-butenyl)coumarin, 8CI, 3-(1,1-Dimethyl-2-propenyl)-7-hydroxy-6-(3-methyl-2-butenyl)-2H-1-benzopyran-2-one, 9CI, 7-Hydroxy-3-(2-methylbut-3-en-2-yl)-6-(3-methylbut-2-en-1-yl)-2H-1-benzopyran-2-one, 7-hydroxy-6-(3-methylbut-2-en-1-yl)-3-(2-methylbut-3-en-2-yl)-2H-chromen-2-one |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 46.5 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC1CCC2CCCCC2C1 |
| Np Classifier Class | Pyranocoumarins, Simple coumarins |
| Deep Smiles | C=CCcccccCC=CC)C))))ccc6oc%10=O)))))O)))))))C)C |
| Heavy Atom Count | 22.0 |
| Classyfire Class | Coumarins and derivatives |
| Scaffold Graph Node Level | OC1CCC2CCCCC2O1 |
| Classyfire Subclass | Hydroxycoumarins |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 509.0 |
| Database Name | cmaup_ingredients;hmdb_chem_all;imppat_phytochem;npass_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Uniprot Id | P22309 |
| Iupac Name | 7-hydroxy-3-(2-methylbut-3-en-2-yl)-6-(3-methylbut-2-enyl)chromen-2-one |
| Nih Violation | False |
| Prediction Hob | 1.0 |
| Class | Coumarins and derivatives |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 5.4 |
| Superclass | Phenylpropanoids and polyketides |
| Is Pains | False |
| Subclass | Hydroxycoumarins |
| Gsk 4 400 Rule | False |
| Molecular Formula | C19H22O3 |
| Scaffold Graph Node Bond Level | O=c1ccc2ccccc2o1 |
| Prediction Swissadme | 1.0 |
| Inchi Key | HEPYYVMIJBDNIM-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Fcsp3 | 0.3157894736842105 |
| Logs | -5.808 |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Logd | 4.168 |
| Synonyms | 3-(1,1-Dimethyl-2-propenyl)-7-hydroxy-6-(3-methyl-2-butenyl)-2H-1-benzopyran-2-one, 9ci, 3-(1,1-Dimethylallyl)-7-hydroxy-6-(3-methyl-2-butenyl)coumarin, 8ci, Gravelliferone methyl ether, gravelliferone, gravelliferone methyl ether |
| Esol Class | Moderately soluble |
| Functional Groups | C=CC, CC=C(C)C, c=O, cO, coc |
| Compound Name | Gravelliferone |
| Kingdom | Organic compounds |
| Prediction Hob Swissadme | 1.0 |
| Exact Mass | 298.157 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 298.157 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 298.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Lipinski Rule Of 5 | True |
| Esol | -4.458732036363636 |
| Inchi | InChI=1S/C19H22O3/c1-6-19(4,5)15-10-14-9-13(8-7-12(2)3)16(20)11-17(14)22-18(15)21/h6-7,9-11,20H,1,8H2,2-5H3 |
| Smiles | CC(=CCC1=C(C=C2C(=C1)C=C(C(=O)O2)C(C)(C)C=C)O)C |
| Nring | 2.0 |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | 7-hydroxycoumarins |
| Np Classifier Superclass | Coumarins |
- 1. Outgoing r'ship
FOUND_INto/from Abutilon Graveolens (Plant) Rel Props:Reference: - 2. Outgoing r'ship
FOUND_INto/from Anethum Graveolens (Plant) Rel Props:Reference: - 3. Outgoing r'ship
FOUND_INto/from Apium Graveolens (Plant) Rel Props:Reference: - 4. Outgoing r'ship
FOUND_INto/from Asteriscus Graveolens (Plant) Rel Props:Reference: - 5. Outgoing r'ship
FOUND_INto/from Astragalus Graveolens (Plant) Rel Props:Reference: - 6. Outgoing r'ship
FOUND_INto/from Boenninghausenia Albiflora (Plant) Rel Props:Reference:ISBN:9770972795006 - 7. Outgoing r'ship
FOUND_INto/from Bursera Graveolens (Plant) Rel Props:Reference: - 8. Outgoing r'ship
FOUND_INto/from Casearia Graveolens (Plant) Rel Props:Reference: - 9. Outgoing r'ship
FOUND_INto/from Clausena Anisata (Plant) Rel Props:Reference:ISBN:9788172362133 - 10. Outgoing r'ship
FOUND_INto/from Clinopodium Graveolens (Plant) Rel Props:Reference: - 11. Outgoing r'ship
FOUND_INto/from Dittrichia Graveolens (Plant) Rel Props:Reference: - 12. Outgoing r'ship
FOUND_INto/from Helichrysum Graveolens (Plant) Rel Props:Reference: - 13. Outgoing r'ship
FOUND_INto/from Luffa Graveolens (Plant) Rel Props:Reference: - 14. Outgoing r'ship
FOUND_INto/from Pelargonium Graveolens (Plant) Rel Props:Reference: - 15. Outgoing r'ship
FOUND_INto/from Peucedanum Graveolens (Plant) Rel Props:Reference: - 16. Outgoing r'ship
FOUND_INto/from Ruta Angustifolia (Plant) Rel Props:Reference: - 17. Outgoing r'ship
FOUND_INto/from Ruta Chalepensis (Plant) Rel Props:Reference: - 18. Outgoing r'ship
FOUND_INto/from Ruta Graveolens (Plant) Rel Props:Source_db:cmaup_ingredients;npass_chem_all - 19. Outgoing r'ship
FOUND_INto/from Ruta Microcarpa (Plant) Rel Props:Reference: - 20. Outgoing r'ship
FOUND_INto/from Ruta Montana (Plant) Rel Props:Reference: - 21. Outgoing r'ship
FOUND_INto/from Ruta Oreojasme (Plant) Rel Props:Reference: - 22. Outgoing r'ship
FOUND_INto/from Ruta Pinnata (Plant) Rel Props:Reference: - 23. Outgoing r'ship
FOUND_INto/from Ruta Tuberculata (Plant) Rel Props:Reference: