2,3,4,6-Tetra-O-methyl-D-galactose
PubChem CID: 14104336
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 2,3,4,6-TETRA-O-METHYL-D-GALACTOSE, 4V31Q6VRI3, 4060-05-3, UNII-4V31Q6VRI3, 2,3,4,6-Tetra-O-methylgalactose, D-, D-Galactose, 2,3,4,6-tetra-O-methyl-, Galactose, 2,3,4,6-tetra-O-methyl-, D-, DTXSID60555940, SCHEMBL5411330, DTXCID90506723, 2,3,4,6-tetra-o-methylgalactose, Q27260541 |
|---|---|
| Ghose Rule | False |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 74.2 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Deep Smiles | COC[C@H][C@@H][C@@H][C@H]C=O))OC)))OC)))OC)))O |
| Heavy Atom Count | 16.0 |
| Classyfire Class | Organooxygen compounds |
| Classyfire Subclass | Carbohydrates and carbohydrate conjugates |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 186.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 4.0 |
| Iupac Name | (2R,3S,4S,5R)-5-hydroxy-2,3,4,6-tetramethoxyhexanal |
| Nih Violation | True |
| Veber Rule | True |
| Classyfire Superclass | Organic oxygen compounds |
| Xlogp | -1.3 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H20O6 |
| Inchi Key | LMWNQPUYOLOJQP-XFWSIPNHSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 9.0 |
| Synonyms | 2,3,4,6-tetra-o-methyl-d-galactose |
| Esol Class | Highly soluble |
| Functional Groups | CC=O, CO, COC |
| Compound Name | 2,3,4,6-Tetra-O-methyl-D-galactose |
| Exact Mass | 236.126 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 236.126 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 236.26 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 4.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H20O6/c1-13-6-7(12)9(15-3)10(16-4)8(5-11)14-2/h5,7-10,12H,6H2,1-4H3/t7-,8+,9+,10-/m1/s1 |
| Smiles | COC[C@H]([C@@H]([C@@H]([C@H](C=O)OC)OC)OC)O |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
- 1. Outgoing r'ship
FOUND_INto/from Senna Surattensis (Plant) Rel Props:Reference:ISBN:9788172362089 - 2. Outgoing r'ship
FOUND_INto/from Spilanthes Acmella (Plant) Rel Props:Reference:ISBN:9788172363093 - 3. Outgoing r'ship
FOUND_INto/from Tamarindus Indica (Plant) Rel Props:Reference:ISBN:9788172363178