Kaempferol 3-O-alpha-L-rhamnofuranoside
PubChem CID: 14078178
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Kaempferol 3-O-alpha-L-rhamnofuranoside, CHEBI:176092, Kaempferol 3-O-a-L-rhamnofuranoside, 3-[3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
|---|---|
| Topological Polar Surface Area | 166.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | FFFIPDPCGREKEW-UHFFFAOYSA-N |
| Rotatable Bond Count | 4.0 |
| State | Solid |
| Synonyms | Kaempferol 3-O-a-L-rhamnofuranoside, Kaempferol 3-O-alpha-L-rhamnofuranoside, Kaempferol 3-rhamnofuranoside, Kaempferol 3-O-α-L-rhamnofuranoside |
| Heavy Atom Count | 31.0 |
| Compound Name | Kaempferol 3-O-alpha-L-rhamnofuranoside |
| Kingdom | Organic compounds |
| Description | Constituent of Prunus spinosa (sloe). Kaempferol 3-rhamnofuranoside is found in many foods, some of which are beverages, sweet bay, herbs and spices, and alcoholic beverages. |
| Exact Mass | 432.106 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 432.106 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 702.0 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 432.4 |
| Database Name | fooddb_chem_all;hmdb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 3-[3,4-dihydroxy-5-(1-hydroxyethyl)oxolan-2-yl]oxy-5,7-dihydroxy-2-(4-hydroxyphenyl)chromen-4-one |
| Total Atom Stereocenter Count | 5.0 |
| Molecular Framework | Aromatic heteropolycyclic compounds |
| Total Bond Stereocenter Count | 0.0 |
| Class | Flavonoids |
| Inchi | InChI=1S/C21H20O10/c1-8(22)18-16(27)17(28)21(30-18)31-20-15(26)14-12(25)6-11(24)7-13(14)29-19(20)9-2-4-10(23)5-3-9/h2-8,16-18,21-25,27-28H,1H3 |
| Smiles | CC(C1C(C(C(O1)OC2=C(OC3=CC(=CC(=C3C2=O)O)O)C4=CC=C(C=C4)O)O)O)O |
| Xlogp | 1.8 |
| Superclass | Phenylpropanoids and polyketides |
| Defined Bond Stereocenter Count | 0.0 |
| Subclass | Flavonoid glycosides |
| Taxonomy Direct Parent | Flavonoid-3-O-glycosides |
| Molecular Formula | C21H20O10 |
- 1. Outgoing r'ship
FOUND_INto/from Laurus Nobilis (Plant) Rel Props:Source_db:fooddb_chem_all