Ovalichalcone
PubChem CID: 14033977
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Ovalichalcone, CHEMBL4455563, 62820-10-4, (E)-1-(2-hydroxy-4,6-dimethoxy-3-(3-methylbut-2-enyl)phenyl)-3-phenylprop-2-en-1-one, (E)-1-[2-hydroxy-4,6-dimethoxy-3-(3-methylbut-2-enyl)phenyl]-3-phenylprop-2-en-1-one, SCHEMBL16166208, BDBM50515398, LMPK12120216, DB-344810, (E)-1-[2-hydroxy-4,6-dimethoxy-3-(3-methyl-2-butenyl)phenyl]-3-phenyl-2-propen-1-one |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 55.8 |
| Hydrogen Bond Donor Count | 1.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | CC(CCC1CCCCC1)C1CCCCC1 |
| Np Classifier Class | Chalcones |
| Deep Smiles | COcccOC))ccc6C=O)/C=C/cccccc6))))))))))O))CC=CC)C |
| Heavy Atom Count | 26.0 |
| Classyfire Class | Linear 1,3-diarylpropanoids |
| Scaffold Graph Node Level | OC(CCC1CCCCC1)C1CCCCC1 |
| Classyfire Subclass | Chalcones and dihydrochalcones |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 500.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | (E)-1-[2-hydroxy-4,6-dimethoxy-3-(3-methylbut-2-enyl)phenyl]-3-phenylprop-2-en-1-one |
| Nih Violation | False |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 5.8 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C22H24O4 |
| Scaffold Graph Node Bond Level | O=C(C=Cc1ccccc1)c1ccccc1 |
| Inchi Key | QDSRQILTOUZIGL-ACCUITESSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 7.0 |
| Synonyms | ovalichalcone |
| Esol Class | Moderately soluble |
| Functional Groups | CC=C(C)C, c/C=C/C(c)=O, cO, cOC |
| Compound Name | Ovalichalcone |
| Exact Mass | 352.167 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 352.167 |
| Hydrogen Bond Acceptor Count | 4.0 |
| Molecular Weight | 352.4 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 1.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C22H24O4/c1-15(2)10-12-17-19(25-3)14-20(26-4)21(22(17)24)18(23)13-11-16-8-6-5-7-9-16/h5-11,13-14,24H,12H2,1-4H3/b13-11+ |
| Smiles | CC(=CCC1=C(C(=C(C=C1OC)OC)C(=O)/C=C/C2=CC=CC=C2)O)C |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 1.0 |
| Egan Rule | True |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Tephrosia Candida (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279