7-Hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one
PubChem CID: 13984467
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Tricin 5-Gucoside, HBA76900 |
|---|---|
| Topological Polar Surface Area | 185.0 |
| Hydrogen Bond Donor Count | 6.0 |
| Inchi Key | FLSOTPIEFVBPBU-UHFFFAOYSA-N |
| Rotatable Bond Count | 6.0 |
| State | liquid |
| Synonyms | Tricin 5-glucoside, Tricin-5-O-beta-D-glucopyranoside |
| Heavy Atom Count | 35.0 |
| Compound Name | 7-Hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Description | Tricin 5-glucoside is a member of the class of compounds known as flavonoid o-glycosides. Flavonoid o-glycosides are compounds containing a carbohydrate moiety which is O-glycosidically linked to the 2-phenylchromen-4-one flavonoid backbone. Tricin 5-glucoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Tricin 5-glucoside can be found in rice, which makes tricin 5-glucoside a potential biomarker for the consumption of this food product. |
| Exact Mass | 492.127 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 492.127 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 762.0 |
| Hydrogen Bond Acceptor Count | 12.0 |
| Molecular Weight | 492.4 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 7-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-5-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-one |
| Total Atom Stereocenter Count | 5.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C23H24O12/c1-31-15-3-9(4-16(32-2)19(15)27)12-7-11(26)18-13(33-12)5-10(25)6-14(18)34-23-22(30)21(29)20(28)17(8-24)35-23/h3-7,17,20-25,27-30H,8H2,1-2H3 |
| Smiles | COC1=CC(=CC(=C1O)OC)C2=CC(=O)C3=C(O2)C=C(C=C3OC4C(C(C(C(O4)CO)O)O)O)O |
| Xlogp | 0.3 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C23H24O12 |
- 1. Outgoing r'ship
FOUND_INto/from Oryza Sativa (Plant) Rel Props:Source_db:fooddb_chem_all