N-gamma-L-Glutamyl-L-methionine
PubChem CID: 13894652
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | N-gamma-Glutamylmethionine, SCHEMBL237466, N-gamma-L-Glutamyl-L-methionine, CHEBI:157877, 2-amino-4-{[1-carboxy-3-(methylsulfanyl)propyl]carbamoyl}butanoic acid, 2-amino-5-[(1-carboxy-3-methylsulanylpropyl)amino]-5-oxopentanoic acid |
|---|---|
| Topological Polar Surface Area | 155.0 |
| Hydrogen Bond Donor Count | 4.0 |
| Inchi Key | RQNSKRXMANOPQY-UHFFFAOYSA-N |
| Rotatable Bond Count | 9.0 |
| Heavy Atom Count | 18.0 |
| Compound Name | N-gamma-L-Glutamyl-L-methionine |
| Description | Isolated from the seeds of onion (Allium cepa), kidney bean (Phaseolus vulgaris), mung bean (Vigna radiata), garlic (Allium sativum) and black gram (Vigna mungo). N-gamma-L-Glutamyl-L-methionine is found in many foods, some of which are pulses, garden onion, soft-necked garlic, and garlic. |
| Exact Mass | 278.094 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 278.094 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 311.0 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 278.33 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 1.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2-amino-5-[(1-carboxy-3-methylsulfanylpropyl)amino]-5-oxopentanoic acid |
| Total Atom Stereocenter Count | 2.0 |
| Nih Violation | False |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C10H18N2O5S/c1-18-5-4-7(10(16)17)12-8(13)3-2-6(11)9(14)15/h6-7H,2-5,11H2,1H3,(H,12,13)(H,14,15)(H,16,17) |
| Smiles | CSCCC(C(=O)O)NC(=O)CCC(C(=O)O)N |
| Xlogp | -3.1 |
| Is Pains | False |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C10H18N2O5S |
- 1. Outgoing r'ship
FOUND_INto/from Allium Sativum (Plant) Rel Props:Source_db:fooddb_chem_all