5,2'-Dihydroxy-6,7,6'-trimethoxyflavanone
PubChem CID: 13889020
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | 5,2'-Dihydroxy-6,7,6'-trimethoxyflavanone, 5-hydroxy-2-(2-hydroxy-6-methoxyphenyl)-6,7-dimethoxy-2,3-dihydrochromen-4-one, CHEBI:196391, LMPK12140601, (+/-)-5,2'-dihydroxy-6,7,6'-trimethoxyflavanone, 100079-36-5 |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 94.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CC(C2CCCCC2)CC2CCCCC12 |
| Np Classifier Class | Flavanones |
| Deep Smiles | COcccOCCC=O)c6cc%10OC)))O)))))ccO)cccc6OC |
| Heavy Atom Count | 25.0 |
| Classyfire Class | Flavonoids |
| Scaffold Graph Node Level | OC1CC(C2CCCCC2)OC2CCCCC12 |
| Classyfire Subclass | O-methylated flavonoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 470.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 5-hydroxy-2-(2-hydroxy-6-methoxyphenyl)-6,7-dimethoxy-2,3-dihydrochromen-4-one |
| Nih Violation | True |
| Veber Rule | True |
| Classyfire Superclass | Phenylpropanoids and polyketides |
| Xlogp | 2.7 |
| Is Pains | False |
| Gsk 4 400 Rule | True |
| Molecular Formula | C18H18O7 |
| Scaffold Graph Node Bond Level | O=C1CC(c2ccccc2)Oc2ccccc21 |
| Inchi Key | WPODUALBMMDCED-UHFFFAOYSA-N |
| Silicos It Class | Moderately soluble |
| Rotatable Bond Count | 4.0 |
| Synonyms | (.+-.)-5,2'-dihydroxy-6,7,6'-trimethoxyflavonone |
| Esol Class | Soluble |
| Functional Groups | cC(C)=O, cO, cOC |
| Compound Name | 5,2'-Dihydroxy-6,7,6'-trimethoxyflavanone |
| Exact Mass | 346.105 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 346.105 |
| Hydrogen Bond Acceptor Count | 7.0 |
| Molecular Weight | 346.3 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 1.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C18H18O7/c1-22-11-6-4-5-9(19)15(11)12-7-10(20)16-13(25-12)8-14(23-2)18(24-3)17(16)21/h4-6,8,12,19,21H,7H2,1-3H3 |
| Smiles | COC1=CC=CC(=C1C2CC(=O)C3=C(C(=C(C=C3O2)OC)OC)O)O |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Np Classifier Superclass | Flavonoids |
- 1. Outgoing r'ship
FOUND_INto/from Scutellaria Discolor (Plant) Rel Props:Reference:https://doi.org/10.15482/usda.adc/1239279