[(5R,7R,8R,9R,10S,11S,12R,13S,17R)-7-acetyloxy-12-hydroxy-17-(2-hydroxy-5-oxo-2H-furan-4-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-11-yl] 2-hydroxy-2-methylpropanoate
PubChem CID: 13875774
Connections displayed (default: 10).
Loading graph...
| Ghose Rule | False |
|---|---|
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 157.0 |
| Hydrogen Bond Donor Count | 3.0 |
| Pfizer 3 75 Rule | True |
| Scaffold Graph Level | CC1CCC2C(CCC3C2CCC2C(C4CCCC4C)CCC23)C1 |
| Np Classifier Class | Apotirucallane triterpenoids, Limonoids |
| Deep Smiles | CC=O)O[C@@H]C[C@@H][C@][C@@H][C@]6C)C=CC[C@H][C@@]5[C@H][C@H]9OC=O)CO)C)C)))))O))C))C=CCOC5=O)))O))))))))))C)C=CC=O)C6C)C |
| Heavy Atom Count | 42.0 |
| Classyfire Class | Prenol lipids |
| Scaffold Graph Node Level | OC1CCC2C(CCC3C2CCC2C(C4CCOC4O)CCC32)C1 |
| Classyfire Subclass | Triterpenoids |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 1340.0 |
| Database Name | imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 9.0 |
| Iupac Name | [(5R,7R,8R,9R,10S,11S,12R,13S,17R)-7-acetyloxy-12-hydroxy-17-(2-hydroxy-5-oxo-2H-furan-4-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-11-yl] 2-hydroxy-2-methylpropanoate |
| Nih Violation | False |
| Veber Rule | False |
| Classyfire Superclass | Lipids and lipid-like molecules |
| Xlogp | 2.6 |
| Is Pains | False |
| Gsk 4 400 Rule | False |
| Molecular Formula | C32H42O10 |
| Scaffold Graph Node Bond Level | O=C1C=CC2C(CCC3C4=CCC(C5=CCOC5=O)C4CCC32)C1 |
| Inchi Key | BQVRARANLWBOLS-IXTPREFVSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 6.0 |
| Synonyms | nimbocinolide |
| Esol Class | Moderately soluble |
| Functional Groups | CC(=O)C=CC, CC(=O)OC, CC1=CC(O)OC1=O, CC=C(C)C, CO |
| Compound Name | [(5R,7R,8R,9R,10S,11S,12R,13S,17R)-7-acetyloxy-12-hydroxy-17-(2-hydroxy-5-oxo-2H-furan-4-yl)-4,4,8,10,13-pentamethyl-3-oxo-5,6,7,9,11,12,16,17-octahydrocyclopenta[a]phenanthren-11-yl] 2-hydroxy-2-methylpropanoate |
| Exact Mass | 586.278 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 586.278 |
| Hydrogen Bond Acceptor Count | 10.0 |
| Molecular Weight | 586.7 |
| Gi Absorption | False |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 10.0 |
| Total Bond Stereocenter Count | 0.0 |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C32H42O10/c1-15(33)40-21-14-19-28(2,3)20(34)11-12-30(19,6)24-23(42-27(38)29(4,5)39)25(36)31(7)17(9-10-18(31)32(21,24)8)16-13-22(35)41-26(16)37/h10-13,17,19,21-25,35-36,39H,9,14H2,1-8H3/t17-,19-,21+,22?,23-,24+,25-,30-,31-,32+/m0/s1 |
| Smiles | CC(=O)O[C@@H]1C[C@@H]2[C@](C=CC(=O)C2(C)C)([C@@H]3[C@@]1(C4=CC[C@H]([C@@]4([C@H]([C@H]3OC(=O)C(C)(C)O)O)C)C5=CC(OC5=O)O)C)C |
| Np Classifier Biosynthetic Pathway | Terpenoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | False |
| Np Classifier Superclass | Triterpenoids |
- 1. Outgoing r'ship
FOUND_INto/from Azadirachta Indica (Plant) Rel Props:Reference:ISBN:9780896038776; ISBN:9788171360536; ISBN:9788172360818