Calcium DL-tartrate
PubChem CID: 13725892
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Calcium tartrate, DL-Tartaric Acid Calcium Salt, 110720-66-6, 3164-34-9, Calcium DL-Tartrate, 5892-21-7, calcium, 2,3-dihydroxybutanedioate, 134841-46-6, Butanedioic acid,2,3-dihydroxy- (2R,3R)-, calcium salt (1:1), Butanedioic acid, 2,3-dihydroxy-, calcium salt (1:1), (2R,3R)-rel-, Racemic Acid Calcium Salt, SCHEMBL81366, calcium 2,3-dihydroxybutanedioate, DTXSID30911837, CHEBI:190512, AKOS015901518, NS00078284, T0002, Butanedioicacid,2,3-dihydroxy-(2R,3R)-,calcium salt,hydrate(1:1:4) |
|---|---|
| Topological Polar Surface Area | 121.0 |
| Hydrogen Bond Donor Count | 2.0 |
| Inchi Key | GUPPESBEIQALOS-UHFFFAOYSA-L |
| Rotatable Bond Count | 1.0 |
| Heavy Atom Count | 11.0 |
| Compound Name | Calcium DL-tartrate |
| Description | Calcium tartrate is also known as mn(iii) tartrate or tartaric acid, calcium salt, (r-r*,r*)-isomer. Calcium tartrate is soluble (in water) and a moderately acidic compound (based on its pKa). Calcium tartrate can be found in tamarind, which makes calcium tartrate a potential biomarker for the consumption of this food product. Calcium tartrate is a byproduct of the wine industry, prepared from wine fermentation dregs. It is the calcium salt of tartaric acid, an acid most commonly found in grapes. Its solubility decreases with lower temperature, which results in the forming of whitish (in red wine often reddish) crystalline clusters as it precipitates. It finds use as a food preservative and acidity regulator. Like tartaric acid, calcium tartrate has two asymmetric carbons, hence it has two chiral isomers and a non-chiral isomer (meso-form). Most calcium tartrate of biological origin is the chiral levorotatory (–) isomer . |
| Exact Mass | 187.963 |
| Formal Charge | 0.0 |
| Monoisotopic Mass | 187.963 |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 123.0 |
| Hydrogen Bond Acceptor Count | 6.0 |
| Molecular Weight | 188.15 |
| Database Name | fooddb_chem_all;pubchem |
| Covalent Unit Count | 2.0 |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | calcium, 2,3-dihydroxybutanedioate |
| Total Atom Stereocenter Count | 2.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C4H6O6.Ca/c5-1(3(7)8)2(6)4(9)10, /h1-2,5-6H,(H,7,8)(H,9,10), /q, +2/p-2 |
| Smiles | C(C(C(=O)[O-])O)(C(=O)[O-])O.[Ca+2] |
| Defined Bond Stereocenter Count | 0.0 |
| Molecular Formula | C4H4CaO6 |
- 1. Outgoing r'ship
FOUND_INto/from Tamarindus Indica (Plant) Rel Props:Source_db:fooddb_chem_all