Durohydroquinone
PubChem CID: 136346
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | Durohydroquinone, Tetramethylhydroquinone, 527-18-4, Dihydroxydurene, 2,3,5,6-tetramethylbenzene-1,4-diol, 1,4-Benzenediol, 2,3,5,6-tetramethyl-, Duro-p-hydroquinone, tetramethylbenzene-1,4-diol, duroquinol, tetramethyl-p-hydroquinone, 2,3,5,6-Tetramethyl-1,4-benzenediol, tetramethyl-p-benzoquinol, Hydroquinone, tetramethyl-, tetramethyl-1,4-benzoquinol, R713G18TVF, 2,3,5,6-Tetramethylhydroquinone, NSC-401619, 1,4-Dihydroxy-2,3,5,6-tetramethylbenzene, UNII-R713G18TVF, tetramethylquinol, DQN, tetramethyl-p-quinol, MFCD00045781, SCHEMBL69786, DUROHYDROQUINONE [MI], 2,5,6-Tetramethylhydroquinone, CHEMBL160233, 2,3,5,6-tetramethylbenzoquinol, DTXSID60200660, CHEBI:189006, Tetramethylhydroquinone, >/=95%, 2,3,5,6-tetramethyl-p-benzoquinol, NSC401619, AKOS022504988, NSC 401619, AS-56753, 2,3,5,6-Tetramethyl-1,4-benzenediol #, 2,3,5,6-tetramethyl-1,4-dihydroquinone, DB-052174, CS-0207010, T0822, T72569, Q27287869, InChI=1/C10H14O2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H,1-4H |
|---|---|
| Ghose Rule | True |
| Classyfire Kingdom | Organic compounds |
| Topological Polar Surface Area | 40.5 |
| Hydrogen Bond Donor Count | 2.0 |
| Pfizer 3 75 Rule | False |
| Scaffold Graph Level | C1CCCCC1 |
| Deep Smiles | CccO)cC)ccc6C))O))C |
| Heavy Atom Count | 12.0 |
| Classyfire Class | Phenols |
| Scaffold Graph Node Level | C1CCCCC1 |
| Classyfire Subclass | Benzenediols |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 124.0 |
| Database Name | hmdb_chem_all;imppat_phytochem;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Iupac Name | 2,3,5,6-tetramethylbenzene-1,4-diol |
| Nih Violation | False |
| Class | Phenols |
| Veber Rule | True |
| Classyfire Superclass | Benzenoids |
| Xlogp | 1.8 |
| Superclass | Benzenoids |
| Is Pains | False |
| Subclass | Benzenediols |
| Gsk 4 400 Rule | True |
| Molecular Formula | C10H14O2 |
| Scaffold Graph Node Bond Level | c1ccccc1 |
| Inchi Key | SUNVJLYYDZCIIK-UHFFFAOYSA-N |
| Silicos It Class | Soluble |
| Rotatable Bond Count | 0.0 |
| Synonyms | Duroquinol, Tetramethylhydroquinone, durohydroquinone |
| Esol Class | Soluble |
| Functional Groups | cO |
| Compound Name | Durohydroquinone |
| Kingdom | Organic compounds |
| Exact Mass | 166.099 |
| Formal Charge | 0.0 |
| Brenk Violation | True |
| Monoisotopic Mass | 166.099 |
| Hydrogen Bond Acceptor Count | 2.0 |
| Molecular Weight | 166.22 |
| Gi Absorption | True |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Molecular Framework | Aromatic homomonocyclic compounds |
| Lipinski Rule Of 5 | True |
| Inchi | InChI=1S/C10H14O2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H,1-4H3 |
| Smiles | CC1=C(C(=C(C(=C1O)C)C)O)C |
| Np Classifier Biosynthetic Pathway | Shikimates and Phenylpropanoids |
| Defined Bond Stereocenter Count | 0.0 |
| Egan Rule | True |
| Taxonomy Direct Parent | Hydroquinones |
- 1. Outgoing r'ship
FOUND_INto/from Mentha Longifolia (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2013.813279 - 2. Outgoing r'ship
FOUND_INto/from Mentha Piperita (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2013.813279 - 3. Outgoing r'ship
FOUND_INto/from Mentha Spicata (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2013.813279 - 4. Outgoing r'ship
FOUND_INto/from Psidium Guajava (Plant) Rel Props:Reference:https://doi.org/10.1080/0972060x.2018.1431152