Hypoxanthine
PubChem CID: 135398638
Connections displayed (default: 10).
Loading graph...
| Compound Synonyms | hypoxanthine, 68-94-0, 6-Hydroxypurine, 9H-Purin-6-ol, 7H-Purin-6-ol, 3H-Purin-6-ol, Sarkin, 6-Oxopurine, Sarcine, 1,7-Dihydro-6H-purin-6-one, Purin-6(1H)-one, Sarkine, Purin-6-ol, Hypoxanthine enol, 6(1H)-Purinone, 9H-Purin-6(1H)-one, Purin-6(3H)-one, 6-Hydroxy-1H-purine, 1h-purin-6-ol, 6H-Purin-6-one, 1,7-dihydro-, Purine-6-ol, 3,7-dihydropurin-6-one, 1,9-dihydro-6H-purin-6-one, 146469-94-5, 95121-06-5, 9H-Purin-6-ol (VAN), 1H-Purin-6-ol (9CI), 51953-04-9, 6H-Purin-6-one, 1,9-dihydro-, 6,7-dihydro-3H-purin-6-one, 146445-70-7, 146469-95-6, 1,7-Dihydro-6H-purine-6-one, Hypoxanthine (VAN), MFCD00005725, NSC 14665, CHEBI:17368, 6H-Purin-6-one, 3,7-dihydro- (9CI), AI3-52242, EINECS 200-697-3, DIDANOSINE IMPURITY A, 1H,7H-Hypoxanthine, DTXSID8045983, HX, 4-Hydroxy-1H-purine, 2TN51YD919, HYPOXANTHINE [MI], NSC-14665, NSC 129419, CHEMBL1427, Hypoxanthine (VAN) (8CI), HYPOXANTHINE [WHO-DD], 6,7-dihydro-1H-purin-6-one, DTXCID6025983, 1246820-04-1, NSC14665, NCGC00095622-01, DIDANOSINE IMPURITY A [EP IMPURITY], 1,7-Dihydro-6H-purin-6-one (Hypoxanthine), AZATHIOPRINE IMPURITY F [EP IMPURITY], Discontinued. See H998503 or H998504, 1H-Purin-6(9H)-one, CAS-68-94-0, 146469-96-7, DIDANOSINE IMPURITY A (EP IMPURITY), AZATHIOPRINE IMPURITY F (EP IMPURITY), purin-6(1H)-on, MERCAPTOPURINE IMPURITY, HYPOXANTHINE-(EP IMPURITY), MERCAPTOPURINE IMPURITY, HYPOXANTHINE-(USP IMPURITY), MERCAPTOPURINE IMPURITY, HYPOXANTHINE-[EP IMPURITY], MERCAPTOPURINE IMPURITY, HYPOXANTHINE-[USP IMPURITY], 6Hydroxypurine, 6oxopurine, UNII-2TN51YD919, 3h-hypoxanthine, 6-hydroxypurin, Purin6ol, 6Hydroxy1Hpurine, 1vfn, 3nrz, 3HPurin6ol, 9HPurin6ol, Hypoxanthine,(S), 6(1H)Purinone, Purin6(1H)one, Purin6(3H)one, Sarcine, Purin-6-ol, purine, 6-hydroxy-, 9HPurin6(1H)one, Spectrum_001417, 1a9q, Hypoxanthine (Standard), 1,7Dihydro6Hpurin6one, 7H-Purin-6-ol #, SpecPlus_000461, Spectrum2_001907, Spectrum3_001352, Spectrum4_001742, Spectrum5_000564, 1,9-dihydropurin-6-one, 3H-Purin-6(9H)-one, bmse000094, Epitope ID:167471, 6HPurin6one, 1,7dihydro, 6HPurin6one, 1,9dihydro, 1,9-Dihydro-purin-6-one, Hypoxanthine, >=99.0%, SCHEMBL25381, BSPBio_003163, KBioGR_002184, KBioSS_001897, SPECTRUM310023, 51953-23-2, DivK1c_006557, Mercaptopurine impurity A CRS, SPBio_001874, GTPL4555, SCHEMBL1867923, SCHEMBL17276814, BDBM82018, FDGQSTZJBFJUBT-UHFFFAOYSA-, HY-N0091R, KBio1_001501, KBio2_001897, KBio2_004465, KBio2_007033, KBio3_002383, CAS_790, NSC_790, 6H-Purin-6-one, 3,7-dihydro-, 6H-Purin-6-one, 3,9-dihydro-, BCP22929, FDC26504, HY-N0091, Tox21_111511, CCG-38478, PDSP1_000299, PDSP2_000297, s2424, STK804424, AKOS000267572, AKOS005221762, AKOS009159101, AKOS015888571, AKOS022168213, Tox21_111511_1, 6-Hydroxypurine, Purin-6-ol, Sarcine, DB04076, FH02949, PS-3167, SDCCGMLS-0065594.P001, SDCCGMLS-0065594.P002, NCGC00095622-04, AC-10518, AC-32451, SY012477, DB-029904, DB-264101, DB-273114, DB-273118, DB-273292, DB-325530, CS-0007792, H0311, NS00010150, SW219908-1, 1,9-Dihydro-6H-purin-6-one, 6-Hydroxypurine, EN300-37579, Hypoxanthine, Vetec(TM) reagent grade, 98%, Hypoxsanthine (1,7-Dihydro-6H-purin-6-one), C00262, Hypoxanthine, Low endotoxin: <= 0.04 EU/mg, AB00674258-01, AC-907/21098001, AG-670/31547063, Q410305, SR-05000002375, SR-05000002375-1, BRD-K03739921-001-06-8, F1386-0269, Z1954805546, Hypoxanthine, powder, BioReagent, suitable for cell culture, MERCAPTOPURINE IMPURITY, HYPOXANTHINE- [EP IMPURITY], 8C229956-6BE8-4F8D-91B7-0AD1EC294077, MERCAPTOPURINE IMPURITY, HYPOXANTHINE- [USP IMPURITY], Didanosine impurity A,, European Pharmacopoeia (EP) Reference Standard, InChI=1/C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10), 200-697-3 |
|---|---|
| Topological Polar Surface Area | 70.1 |
| Hydrogen Bond Donor Count | 2.0 |
| Heavy Atom Count | 10.0 |
| Pathway Kegg Map Id | map00230 |
| Description | Occurs widely in plant and animal tissue (CCD). Hypoxanthine is found in many foods, some of which are japanese chestnut, parsnip, okra, and horned melon. |
| Isotope Atom Count | 0.0 |
| Molecular Complexity | 190.0 |
| Database Name | fooddb_chem_all;pubchem |
| Defined Atom Stereocenter Count | 0.0 |
| Enzyme Uniprot Id | Q14542, P00491 |
| Iupac Name | 1,7-dihydropurin-6-one |
| Nih Violation | False |
| Class | Imidazopyrimidines |
| Xlogp | -0.5 |
| Superclass | Organoheterocyclic compounds |
| Is Pains | False |
| Subclass | Purines and purine derivatives |
| Molecular Formula | C5H4N4O |
| Inchi Key | FDGQSTZJBFJUBT-UHFFFAOYSA-N |
| Rotatable Bond Count | 0.0 |
| State | Solid |
| Synonyms | 1,7-dihydro-6H-Purin-6-one, 1,7-Dihydro-6H-purine-6-one, 1,9-Dihydro-purin-6-one, 1H,7H-Hypoxanthine, 3H-Purin-6-ol, 4-Hydroxy-1H-purine, 6-Hydroxy-1H-purine, 6-Hydroxypurine, 6-Oxopurine, 6(1H)-Purinone, 6H-Purin-6-one, 1,7-dihydro-, 6H-Purin-6-one, 1,9-dihydro-, 7H-Purin-6-ol, 9H-Purin-6-ol, 9H-Purin-6(1H)-one, Hyp, Hypoxanthine, Hypoxanthine enol, Imidazo[5,4-d]pyrimidine, 6-hydroxy-, Purin-6-ol, Purin-6(1H)-one, Purin-6(3H)-one, Purine-6-ol, Sarcine, Sarkin, Sarkine |
| Substituent Name | Hypoxanthine, Hydroxypyrimidine, Pyrimidine, Heteroaromatic compound, Imidazole, Azole, Azacycle, Hydrocarbon derivative, Organooxygen compound, Organonitrogen compound, Aromatic heteropolycyclic compound |
| Compound Name | Hypoxanthine |
| Kingdom | Organic compounds |
| Exact Mass | 136.039 |
| Formal Charge | 0.0 |
| Brenk Violation | False |
| Monoisotopic Mass | 136.039 |
| Hydrogen Bond Acceptor Count | 3.0 |
| Molecular Weight | 136.11 |
| Covalent Unit Count | 1.0 |
| Total Atom Stereocenter Count | 0.0 |
| Total Bond Stereocenter Count | 0.0 |
| Inchi | InChI=1S/C5H4N4O/c10-5-3-4(7-1-6-3)8-2-9-5/h1-2H,(H2,6,7,8,9,10) |
| Smiles | C1=NC2=C(N1)C(=O)NC=N2 |
| Defined Bond Stereocenter Count | 0.0 |
- 1. Outgoing r'ship
FOUND_INto/from Apium Graveolens (Plant) Rel Props:Source_db:fooddb_chem_all - 2. Outgoing r'ship
FOUND_INto/from Avena Sativa (Plant) Rel Props:Source_db:fooddb_chem_all - 3. Outgoing r'ship
FOUND_INto/from Beta Vulgaris (Plant) Rel Props:Source_db:fooddb_chem_all - 4. Outgoing r'ship
FOUND_INto/from Camellia Sinensis (Plant) Rel Props:Source_db:fooddb_chem_all - 5. Outgoing r'ship
FOUND_INto/from Coffea Arabica (Plant) Rel Props:Source_db:fooddb_chem_all - 6. Outgoing r'ship
FOUND_INto/from Glycine Max (Plant) Rel Props:Source_db:fooddb_chem_all - 7. Outgoing r'ship
FOUND_INto/from Oryza Sativa (Plant) Rel Props:Source_db:fooddb_chem_all - 8. Outgoing r'ship
FOUND_INto/from Solanum Tuberosum (Plant) Rel Props:Source_db:fooddb_chem_all